1,2,3,4-diepoxybutane
fo-361a3fc47a05ee88
Identity
- Type
- Imprecise chemical mixture
- CAS
- 298-18-0
- EC
- 206-060-6
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 53 across every transformer
Alternative labels
14- (+-)-1,2:3,4-diepoxybutane
- (R*,R*)-(+-)-2,2'-bioxirane
- (±)-1,2:3,4-Diepoxybutane
- (±)-Diepoxybutane
- 2,2′-Bioxirane, (2R,2′R)-rel-
- 2,2′-Bioxirane, (R*,R*)-
- 2,2′-Bioxirane, (R*,R*)-(±)-
- Butane, 1,2:3,4-diepoxy-, (±)-
- dl-1,2:3,4-Diepoxybutane
- DL-Diepoxybutane
- Rac-1,3-Butadiene diepoxide
- rel-(2R,2'R)-2,2'-bioxirane
- rel-(2R,2′R)-2,2′-Bioxirane
- Threitol, 1,2:3,4-dianhydro-, DL-
Properties
| Property | Value |
|---|---|
| Elemental charge chemrof:elemental_charge | 0 |
| InChI2D key string chemrof:inchi2d_key_string | ZFIVKAOQEXOYFY-SEFKMRKONA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1/C4H6O2/c1-3(5-1)4-2-6-4/h3-4H,1-2H2/t3-,4-/s2 |
| Molecular formula chemrof:molecular_formula | C4H6O2 |
| Molecular mass chemrof:molecular_mass | 86.089 |
| Monoisotopic mass chemrof:monoisotopic_mass | 86.03678 |
Known URLs
2Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=298-18-0 | enrich_references.chebi_xrefs |
| ChEBI | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:51049 | enrich_references.chebi_id_link |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 7a4796db-a674-4171-9b1d-4a29cf838b8f | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 0 |
| c2a5e2fb-87b3-41ff-b7bf-111b35d5971d | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 0 |
| de033736-7203-42ca-a63a-da613fe2a4bb | Environmental → Air → Indoor | EF 3.1 | kg | 0 |
| 86447785-8722-458e-ae5b-739542cafa75 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 849e43aa-3ea4-4b21-b125-7499ae95b0d2 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 0 |
| 86677b64-aa55-4a6a-8717-94eba9455cc5 | Environmental → Air → Unknown | EF 3.1 | kg | 0 |
| c35b7f41-aea6-428f-820d-891381dfb018 | Environmental → Ground → Agricultural | EF 3.1 | kg | 0 |
| 04733ebc-7b58-47b8-8d58-0ac3c3f966cf | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 0 |
| 42cd2e83-5f82-4a34-b594-3abfc8fb5572 | Environmental → Ground → Unknown | EF 3.1 | kg | 0 |
| f1eb102e-57bf-4371-a56c-e327fc873748 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| c85fc605-7ae0-486d-80af-2b474664b94e | Environmental → Water → Ocean | EF 3.1 | kg | 0 |
| dd146fda-d386-4620-acb4-e4a06c0a79f7 | Environmental → Water → Surface water | EF 3.1 | kg | 0 |
| 28e7e92b-5597-4de8-b3fd-306fd7c806b3 | Environmental → Water → Unknown | EF 3.1 | kg | 0 |
History
Everything that changed this substance (53 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-361a3fc47a05ee88",
"prefLabel": [
{
"@value": "1,2,3,4-diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "(+-)-1,2:3,4-diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "(R*,R*)-(+-)-2,2'-bioxirane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "(±)-1,2:3,4-Diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "(±)-Diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,2′-Bioxirane, (2R,2′R)-rel-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,2′-Bioxirane, (R*,R*)-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,2′-Bioxirane, (R*,R*)-(±)-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Butane, 1,2:3,4-diepoxy-, (±)-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "dl-1,2:3,4-Diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "DL-Diepoxybutane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Rac-1,3-Butadiene diepoxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "rel-(2R,2'R)-2,2'-bioxirane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "rel-(2R,2′R)-2,2′-Bioxirane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Threitol, 1,2:3,4-dianhydro-, DL-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:298-18-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C4H6O2"
],
"attested_by": {
"C4H6O2": [
"enrich_references.chebi_semantic"
]
},
"rdfs:label": "Molecular formula",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.generalized_empirical_formula"
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"@value": [
86.089
],
"attested_by": {
"86.089": [
"enrich_references.chebi_semantic"
]
},
"rdfs:label": "Molecular mass",
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.mass"
}
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"@value": [
86.03678
],
"attested_by": {
"86.03678": [
"enrich_references.chebi_semantic"
]
},
"rdfs:label": "Monoisotopic mass",
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.monoisotopic_mass"
}
},
"https://w3id.org/chemrof/elemental_charge": {
"@id": "https://w3id.org/chemrof/elemental_charge",
"@value": [
0
],
"attested_by": {
"0": [
"enrich_references.chebi_semantic"
]
},
"rdfs:label": "Elemental charge",
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/NUM",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.charge"
}
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"rdfs:label": "InChIKey",
"@value": [
"ZFIVKAOQEXOYFY-SEFKMRKONA-N"
],
"provenance": {
"prov:wasGeneratedBy": "commonchemistry_registered_structure",
"prov:wasAttributedTo": "CAS Common Chemistry",
"prov:hadPrimarySource": [
"298-18-0"
],
"prov:wasDerivedFrom": "registered structure, corroborated by a registered name"
},
"attested_by": {
"ZFIVKAOQEXOYFY-SEFKMRKONA-N": [
"commonchemistry_registered_structure"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1/C4H6O2/c1-3(5-1)4-2-6-4/h3-4H,1-2H2/t3-,4-/s2"
],
"provenance": {
"prov:wasGeneratedBy": "commonchemistry_registered_structure",
"prov:wasAttributedTo": "CAS Common Chemistry",
"prov:hadPrimarySource": [
"298-18-0"
],
"prov:wasDerivedFrom": "registered structure, corroborated by a registered name"
},
"attested_by": {
"InChI=1/C4H6O2/c1-3(5-1)4-2-6-4/h3-4H,1-2H2/t3-,4-/s2": [
"commonchemistry_registered_structure"
]
}
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=298-18-0",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:51049",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_id_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_51049"
],
"prov:wasDerivedFrom": "chebi.id"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "04733ebc-7b58-47b8-8d58-0ac3c3f966cf",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "registered_without_structure",
"reason": "",
"types": [
"https://w3id.org/chemrof/ImpreciseChemicalMixture"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.registered_without_structure"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"298-18-0"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=298-18-0"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"206-060-6"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=206-060-6"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/ImpreciseChemicalMixture"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works