Ammonium Hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
fo-65ef9e7daed0a8cf
Identity
- Type
- Chemical salt
- CAS
- 34274-28-7
- EC
- 251-908-0
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 54 across every transformer
Structure
Alternative labels
7- Aminotrimethylenephosphonic acid ammonium salt
- Aminotris(methylenephosphonic acid) ammonium salt
- Ammonium nitrilotris(methylenephosphonate)
- Nitrilo-tris(methylene)phosphonic acid ammonium salt
- Phosphonic acid, [nitrilotris(methylene)]tri-, ammonium salt
- Phosphonic acid, [nitrilotris(methylene)]tris-, ammonium salt
- Phosphonic acid, P,P′,P′′-[nitrilotris(methylene)]tris-, ammonium salt (1:?)
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | QLBMTYBUHJKAQD-UHFFFAOYSA-I |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C3H12NO9P3.H3N/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13;/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13);1H3/p-5 |
| IUPAC name chemrof:IUPAC_name | ammonium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine, ammonium tris(phosphonatomethyl)amine, azanium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine |
| Molecular formula chemrof:molecular_formula | C3H10N2O9P3-5 |
| Molecular mass chemrof:molecular_mass | 311.04 |
| Monoisotopic mass chemrof:monoisotopic_mass | 310.962658 |
| SMILES string chemrof:smiles_string | C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+] |
Known URLs
3Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=34274-28-7 | enrich_references.consensus_cas_link |
| chem.echa.europa.eu | https://chem.echa.europa.eu/100.047.174 | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/161809 | enrich_references.pubchem_compound |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| da9f3b06-7495-466c-bb8e-665303429de4 | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| e2eebcf8-f62b-4ed8-9763-5d7fb2447307 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| 0708c86b-5a10-4a93-b7f8-d013b3a68d07 | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| be5c9db8-72c2-4b0b-b3c5-597ef9bad9a7 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 4cb84e40-fe92-4a53-aa89-92327be9148a | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| 7fbd120b-6ae8-46e9-b2e7-64efd138c768 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| 63bef9d4-d963-44ff-bb2a-65cd58245693 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| 839cd55c-953a-4044-806a-801d01709218 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| c51f90d8-8089-4037-9ceb-dd17922d5238 | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| ee3288d5-6251-4ff2-bb3c-0a84753e6462 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| c9e3c71c-87a4-4e52-95f7-b3ce491c4fca | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| dba5e37c-89ac-48e8-b27c-ddcbccb6a3a6 | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| 8b9556c4-c9c3-4728-9d6d-5ca63fbf76cf | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (54 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-65ef9e7daed0a8cf",
"prefLabel": [
{
"@value": "Ammonium Hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "Aminotrimethylenephosphonic acid ammonium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Aminotris(methylenephosphonic acid) ammonium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ammonium nitrilotris(methylenephosphonate)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Nitrilo-tris(methylene)phosphonic acid ammonium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphonic acid, [nitrilotris(methylene)]tri-, ammonium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphonic acid, [nitrilotris(methylene)]tris-, ammonium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphonic acid, P,P′,P′′-[nitrilotris(methylene)]tris-, ammonium salt (1:?)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:34274-28-7",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C3H10N2O9P3-5"
],
"attested_by": {
"C3H10N2O9P3-5": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"QLBMTYBUHJKAQD-UHFFFAOYSA-I"
],
"attested_by": {
"QLBMTYBUHJKAQD-UHFFFAOYSA-I": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
],
"attested_by": {
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C3H12NO9P3.H3N/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13;/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13);1H3/p-5"
],
"attested_by": {
"InChI=1S/C3H12NO9P3.H3N/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13;/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13);1H3/p-5": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"ammonium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine",
"ammonium tris(phosphonatomethyl)amine",
"azanium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine"
],
"attested_by": {
"ammonium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine": [
"enrich_references.pubchem_semantic"
],
"ammonium tris(phosphonatomethyl)amine": [
"enrich_references.pubchem_semantic"
],
"azanium 1-phosphonato-N,N-bis(phosphonatomethyl)methanamine": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
311.04
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
],
"attested_by": {
"311.04": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
310.962658
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C(N(CP(=O)([O-])[O-])CP(=O)([O-])[O-])P(=O)([O-])[O-].[NH4+]"
]
}
],
"attested_by": {
"310.962658": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://chem.echa.europa.eu/100.047.174",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809;CAS:34274-28-7"
],
"prov:wasDerivedFrom": "pubchem.identifiers[34274-28-7]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=34274-28-7",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"34274-28-7"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/161809",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:161809;CAS:34274-28-7"
],
"prov:wasDerivedFrom": "pubchem.by_cas[34274-28-7]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "0708c86b-5a10-4a93-b7f8-d013b3a68d07",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "multi_component_ionic",
"reason": "",
"types": [
"https://w3id.org/chemrof/ChemicalSalt"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.multi_component_ionic"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"34274-28-7"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=34274-28-7"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"251-908-0"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=251-908-0"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/ChemicalSalt"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works