Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate
fo-66df33416fb042d9
Identity
- Type
- Neutral molecule
- CAS
- 7237-83-4
- EC
- 230-638-7
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 54 across every transformer
Structure
Alternative labels
6- 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-oxiranylmethyl) ester
- 1,2,4-Benzenetricarboxylic acid, tris(2,3-epoxypropyl) ester
- 1,2,4-Benzenetricarboxylic acid, tris(oxiranylmethyl) ester
- 1-Propanol, 2,3-epoxy-, 1,2,4-benzenetricarboxylate (3:1)
- Triglycidyl mellitate
- Triglycidyl trimellitate
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | YNOWBNNLZSSIHM-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C18H18O9/c19-16(25-7-11-4-22-11)10-1-2-14(17(20)26-8-12-5-23-12)15(3-10)18(21)27-9-13-6-24-13/h1-3,11-13H,4-9H2 |
| IUPAC name chemrof:IUPAC_name | Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate |
| Molecular formula chemrof:molecular_formula | C18H18O9 |
| Molecular mass chemrof:molecular_mass | 378.333 |
| Monoisotopic mass chemrof:monoisotopic_mass | 378.095082 |
| SMILES string chemrof:smiles_string | O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1 |
Known URLs
6Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=7237-83-4 | enrich_references.pubchem_identifier_url |
| chem.echa.europa.eu | https://chem.echa.europa.eu/100.027.853 | enrich_references.pubchem_identifier_url |
| comptox.epa.gov | https://comptox.epa.gov/dashboard/DTXSID40864027 | enrich_references.pubchem_identifier_url |
| jglobal.jst.go.jp | http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J212.255C | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/111281 | enrich_references.pubchem_compound |
| Wikidata | https://www.wikidata.org/wiki/Q126610046 | enrich_references.pubchem_identifier_url |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 9a5cbc60-628a-4235-bb61-6affd42001dd | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 24859c7a-865d-4eba-b95e-f2dbb55b04b8 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| 52869189-1e05-4244-a765-b8de296bfce0 | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| a5bfb276-fcf1-4f0e-96cb-fbab736ccd5d | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| f0367c6b-6b5c-49e2-91fa-efdb8b5762d3 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| b2d2e859-7781-43c9-a5da-f8a2912fc97f | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| 42ecca57-a9f6-4318-af3c-c067d9b5fa1f | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| f925d7aa-ae27-4fdc-b747-657c7ae2e5d8 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| b31b7522-7d06-48c7-b541-6eb3a462cb03 | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| 65a5d514-8c0a-415b-80fa-5c13187d1f35 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 241fe166-6955-4373-944f-104f4823e7cc | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| 79bc534d-71aa-4473-b7d4-cfeb06c52348 | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| d70d8bfe-1944-46a7-a3c1-ccd284bcc770 | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (54 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-66df33416fb042d9",
"prefLabel": [
{
"@value": "Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-oxiranylmethyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1,2,4-Benzenetricarboxylic acid, tris(2,3-epoxypropyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1,2,4-Benzenetricarboxylic acid, tris(oxiranylmethyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1-Propanol, 2,3-epoxy-, 1,2,4-benzenetricarboxylate (3:1)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Triglycidyl mellitate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Triglycidyl trimellitate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:7237-83-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C18H18O9"
],
"attested_by": {
"C18H18O9": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"YNOWBNNLZSSIHM-UHFFFAOYSA-N"
],
"attested_by": {
"YNOWBNNLZSSIHM-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
],
"attested_by": {
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C18H18O9/c19-16(25-7-11-4-22-11)10-1-2-14(17(20)26-8-12-5-23-12)15(3-10)18(21)27-9-13-6-24-13/h1-3,11-13H,4-9H2"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
],
"attested_by": {
"InChI=1S/C18H18O9/c19-16(25-7-11-4-22-11)10-1-2-14(17(20)26-8-12-5-23-12)15(3-10)18(21)27-9-13-6-24-13/h1-3,11-13H,4-9H2": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate"
]
},
"attested_by": {
"Tris(oxiran-2-ylmethyl) Benzene-1,2,4-tricarboxylate": [
"opsin_iupac"
]
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
378.333
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1C(O1)COC(=O)C2=CC(=C(C=C2)C(=O)OCC3CO3)C(=O)OCC4CO4"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
],
"attested_by": {
"378.333": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
378.095082
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1C(O1)COC(=O)C2=CC(=C(C=C2)C(=O)OCC3CO3)C(=O)OCC4CO4"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1"
]
}
],
"attested_by": {
"378.095082": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J212.255C",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[7237-83-4]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.027.853",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[7237-83-4]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=7237-83-4",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[7237-83-4]"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID40864027",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[7237-83-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/111281",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.by_cas[7237-83-4]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q126610046",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:111281;CAS:7237-83-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[7237-83-4]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "241fe166-6955-4373-944f-104f4823e7cc",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "neutral_molecule",
"reason": "",
"types": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.neutral_molecule"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"7237-83-4"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=7237-83-4"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"230-638-7"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=230-638-7"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works