Methacrylamide Sulfate
fo-79a9803d0c7980b9
Identity
- Type
- Molecular complex
- CAS
- 29194-31-8
- EC
- 249-497-8
- Origin
- ecoinvent-3.12 hybrid_name_cas_v1
- Changes
- 0 across every transformer
Structure
Alternative labels
3- 2-Propenamide, 2-methyl-, sulfate
- 2-Propenamide, 2-methyl-, sulfate (1:?)
- Methacrylamide, sulfate
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | NTQWADDNQQUGRH-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4) |
| IUPAC name chemrof:IUPAC_name | Methacrylamide Sulfate |
| Molecular formula chemrof:molecular_formula | C4H9NO5S |
| Molecular mass chemrof:molecular_mass | 183.185 |
| Monoisotopic mass chemrof:monoisotopic_mass | 183.020143 |
| SMILES string chemrof:smiles_string | C=C(C)C(=N)O.O=S(=O)(O)O |
Known URLs
1Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=29194-31-8 | enrich_references.consensus_cas_link |
Elementary flows
1| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 59e7d0ce2e6075a0477bc4db870e88691e5e8488 | Environmental → Water → Unknown | ecoinvent algorithm addition | kg | 0 |
History
Everything that changed this substance (0 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-79a9803d0c7980b9",
"prefLabel": [
{
"@value": "Methacrylamide Sulfate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent-3.12"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "2-Propenamide, 2-methyl-, sulfate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:29194-31-8",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=29194-31-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Propenamide, 2-methyl-, sulfate (1:?)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:29194-31-8",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=29194-31-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Methacrylamide, sulfate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:29194-31-8",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=29194-31-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Methacrylamide Sulfate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Methacrylamide Sulfate"
]
},
"attested_by": {
"Methacrylamide Sulfate": [
"opsin_iupac"
]
}
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"C=C(C)C(=N)O.O=S(=O)(O)O": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"rdfs:label": "InChIKey",
"@value": [
"NTQWADDNQQUGRH-UHFFFAOYSA-N"
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"NTQWADDNQQUGRH-UHFFFAOYSA-N": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"rdfs:label": "Molecular formula",
"@value": [
"C4H9NO5S"
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"C4H9NO5S": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
183.185
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"183.185": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
183.020143
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_authoritative",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"InChI=1S/C4H7NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h1H2,2H3,(H2,5,6);(H2,1,2,3,4)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=C(C)C(=N)O.O=S(=O)(O)O"
]
}
],
"attested_by": {
"183.020143": [
"rdkit_authoritative",
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=29194-31-8",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"29194-31-8"
],
"prov:wasDerivedFrom": "cas_numbers"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "ac52a8fa-d727-454e-9769-293445220f7b",
"seed_source": "ecoinvent-3.12",
"semantic_typing": {
"rule": "multi_component_neutral",
"reason": "",
"types": [
"https://w3id.org/chemrof/MolecularComplex"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.multi_component_neutral"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"29194-31-8"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=29194-31-8"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=29194-31-8"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent-3.12"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"249-497-8"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=249-497-8"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent-3.12"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works