Methylbenzenesulfonamide
fo-93af51d6a3414086
Identity
- Type
- Molecular complex
- CAS
- 1333-07-9
- EC
- 215-578-1
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 54 across every transformer
Structure
This substance carries 2 candidate structures; the diagram is the first one RDKit could parse, not a settled answer.
Alternative labels
7- ar-Methylbenzenesulfonamide
- ar-Toluenesulfonamide
- Benzenesulfonamide, ar-methyl-
- Ketjenflex 15
- Ketjenflex 3
- Ketjenflex 7
- Toluenesulfonamide
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | KCTLGSREBLDQRJ-UHFFFAOYSA-N, VXGAPBLISGTEKE-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/2C7H9NO2S/c1-6-2-4-7(5-3-6)11(8,9)10;1-6-4-2-3-5-7(6)11(8,9)10/h2*2-5H,1H3,(H2,8,9,10), InChI=1S/C6H7NO2S.CH4/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);1H4 |
| IUPAC name chemrof:IUPAC_name | 2-methylbenzenesulfonamide;4-methylbenzenesulfonamide, benzenesulfonamide;methane |
| Molecular formula chemrof:molecular_formula | C14H18N2O4S2, C7H11NO2S |
| SMILES string chemrof:smiles_string | C.C1=CC=C(C=C1)S(=O)(=O)N, CC1=CC=C(C=C1)S(=O)(=O)N.CC1=CC=CC=C1S(=O)(=O)N |
Known URLs
3Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=1333-07-9 | enrich_references.consensus_cas_link |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/19385235 | enrich_references.pubchem_compound |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/69536424 | enrich_references.pubchem_compound |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| fef14aa8-60ee-4877-88da-e549023d1fa9 | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 4 |
| b6403433-93c3-4ff1-b371-2fe19d3eadbf | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 4 |
| 73d18ece-a030-473f-902d-152901756831 | Environmental → Air → Indoor | EF 3.1 | kg | 4 |
| 79655ac1-c04d-44c3-a49b-1abf69c50a43 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 8c87311c-663f-4e63-a836-1a07a698c24e | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 4 |
| 0d5440f1-4f6f-441e-a7fe-883da4ab80a5 | Environmental → Air → Unknown | EF 3.1 | kg | 4 |
| af369a0c-9553-4e4c-856a-f379c4139767 | Environmental → Ground → Agricultural | EF 3.1 | kg | 4 |
| f85b532f-7925-49ba-ace6-92f8981ae8c4 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 4 |
| e86235fc-9fe6-42e8-b686-19d522bf461a | Environmental → Ground → Unknown | EF 3.1 | kg | 4 |
| 009bd151-3422-4f07-bf28-bac3ea5cbe30 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 15312d89-e95c-4bd8-9c52-af0e4243923e | Environmental → Water → Ocean | EF 3.1 | kg | 4 |
| ac444ae9-6076-4dbf-a277-44b93da449ed | Environmental → Water → Surface water | EF 3.1 | kg | 4 |
| 790913ce-d42e-4a08-a71f-3b5a85245815 | Environmental → Water → Unknown | EF 3.1 | kg | 4 |
History
Everything that changed this substance (54 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-93af51d6a3414086",
"prefLabel": [
{
"@value": "Methylbenzenesulfonamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "ar-Methylbenzenesulfonamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "ar-Toluenesulfonamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Benzenesulfonamide, ar-methyl-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ketjenflex 15",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ketjenflex 3",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ketjenflex 7",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Toluenesulfonamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1333-07-9",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C14H18N2O4S2",
"C7H11NO2S"
],
"attested_by": {
"C14H18N2O4S2": [
"enrich_references.pubchem_semantic"
],
"C7H11NO2S": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235",
"CID:69536424"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C.C1=CC=C(C=C1)S(=O)(=O)N"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"KCTLGSREBLDQRJ-UHFFFAOYSA-N",
"VXGAPBLISGTEKE-UHFFFAOYSA-N"
],
"attested_by": {
"KCTLGSREBLDQRJ-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"VXGAPBLISGTEKE-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235",
"CID:69536424"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C.C1=CC=C(C=C1)S(=O)(=O)N"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"C.C1=CC=C(C=C1)S(=O)(=O)N",
"CC1=CC=C(C=C1)S(=O)(=O)N.CC1=CC=CC=C1S(=O)(=O)N"
],
"attested_by": {
"C.C1=CC=C(C=C1)S(=O)(=O)N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"CC1=CC=C(C=C1)S(=O)(=O)N.CC1=CC=CC=C1S(=O)(=O)N": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235",
"CID:69536424"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C.C1=CC=C(C=C1)S(=O)(=O)N"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/2C7H9NO2S/c1-6-2-4-7(5-3-6)11(8,9)10;1-6-4-2-3-5-7(6)11(8,9)10/h2*2-5H,1H3,(H2,8,9,10)",
"InChI=1S/C6H7NO2S.CH4/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);1H4"
],
"attested_by": {
"InChI=1S/2C7H9NO2S/c1-6-2-4-7(5-3-6)11(8,9)10;1-6-4-2-3-5-7(6)11(8,9)10/h2*2-5H,1H3,(H2,8,9,10)": [
"enrich_references.pubchem_semantic"
],
"InChI=1S/C6H7NO2S.CH4/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);1H4": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235",
"CID:69536424"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C.C1=CC=C(C=C1)S(=O)(=O)N"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"2-methylbenzenesulfonamide;4-methylbenzenesulfonamide",
"benzenesulfonamide;methane"
],
"attested_by": {
"2-methylbenzenesulfonamide;4-methylbenzenesulfonamide": [
"enrich_references.pubchem_semantic"
],
"benzenesulfonamide;methane": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235",
"CID:69536424"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=1333-07-9",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"1333-07-9"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/19385235",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:19385235;CAS:1333-07-9"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1333-07-9]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/69536424",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:69536424;CAS:1333-07-9"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1333-07-9]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "009bd151-3422-4f07-bf28-bac3ea5cbe30",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "multi_component_neutral",
"reason": "",
"types": [
"https://w3id.org/chemrof/MolecularComplex"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.multi_component_neutral"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"1333-07-9"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=1333-07-9"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"215-578-1"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=215-578-1"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works