Menthol
fo-9fba49b735944336
Identity
- Type
- Imprecise chemical mixture
- CAS
- 89-78-1
- EC
- 201-939-0
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 53 across every transformer
Alternative labels
3- rac-(1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol
- racementholum
- racementol
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | NOOLISFMXDJSKH-WYVCTLLJNA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/s2 |
| Molecular formula chemrof:molecular_formula | C10H20O |
Known URLs
6Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| agr | agr:IND20570977 | enrich_references.chebi_xrefs |
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=89-78-1 | enrich_references.chebi_xrefs |
| ChEBI | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:76310 | enrich_references.chebi_id_link |
| KEGG | https://www.genome.jp/entry/D04849 | enrich_references.chebi_xrefs |
| PubMed | https://pubmed.ncbi.nlm.nih.gov/12806393 | enrich_references.chebi_xrefs |
| PubMed | https://pubmed.ncbi.nlm.nih.gov/18640200 | enrich_references.chebi_xrefs |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 46ca21f4-2375-482d-a3b2-2fb66413bc5c | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 7a16c4ed-88a9-4807-b75a-5baefd01d44e | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| 28a8e8ee-b317-489a-af51-ad2aa6b51817 | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| 6ec7fe6e-759b-4898-9c77-0130e37aa1c6 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 92432ccf-5121-4c2d-984f-e5212e5754ca | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| abf014d8-45d1-454f-acac-bb738f0c94d0 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| a4f84c07-0946-461d-9811-81adedb7fe39 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| d2b1439a-25c7-486b-a8d0-bec00f2b4374 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| b0e6f1fe-ec68-402b-939d-58dc418cd57e | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| 746c0b9c-5533-47ca-b678-78ad6f6ca545 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 3b352488-207d-4d00-8d66-d809ad1cb3b8 | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| 0b3560b9-b288-486f-a837-3dd563f88425 | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| b3e81513-b441-4786-812f-8eb15bad6478 | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (53 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-9fba49b735944336",
"prefLabel": [
{
"@value": "Menthol",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "rac-(1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "racementholum",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "racementol",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
}
],
"properties": {
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"rdfs:label": "InChIKey",
"@value": [
"NOOLISFMXDJSKH-WYVCTLLJNA-N"
],
"provenance": {
"prov:wasGeneratedBy": "commonchemistry_registered_structure",
"prov:wasAttributedTo": "CAS Common Chemistry",
"prov:hadPrimarySource": [
"89-78-1"
],
"prov:wasDerivedFrom": "registered structure, corroborated by a registered name"
},
"attested_by": {
"NOOLISFMXDJSKH-WYVCTLLJNA-N": [
"commonchemistry_registered_structure"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/s2"
],
"provenance": {
"prov:wasGeneratedBy": "commonchemistry_registered_structure",
"prov:wasAttributedTo": "CAS Common Chemistry",
"prov:hadPrimarySource": [
"89-78-1"
],
"prov:wasDerivedFrom": "registered structure, corroborated by a registered name"
},
"attested_by": {
"InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/s2": [
"commonchemistry_registered_structure"
]
}
},
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"rdfs:label": "molecular formula",
"@value": [
"C10H20O"
],
"provenance": {
"prov:wasGeneratedBy": "commonchemistry_registered_structure",
"prov:wasAttributedTo": "CAS Common Chemistry",
"prov:hadPrimarySource": [
"89-78-1"
],
"prov:wasDerivedFrom": "registered structure, corroborated by a registered name"
},
"attested_by": {
"C10H20O": [
"commonchemistry_registered_structure"
]
}
}
},
"references": [
{
"@id": "agr:IND20570977",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=89-78-1",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://pubmed.ncbi.nlm.nih.gov/12806393",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://pubmed.ncbi.nlm.nih.gov/18640200",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:76310",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_id_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.id"
}
},
{
"@id": "https://www.genome.jp/entry/D04849",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "0b3560b9-b288-486f-a837-3dd563f88425",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "registered_without_structure",
"reason": "",
"types": [
"https://w3id.org/chemrof/ImpreciseChemicalMixture"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.registered_without_structure"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"89-78-1"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=89-78-1"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=89-78-1"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"201-939-0"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=201-939-0"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"http://www.w3.org/2004/02/skos/core#definition": [
{
"@value": "A racemate comprising equimolar amounts of (+)- and (−)-menthol. Both (±)- and (−)-menthol are used to relieve symptoms of conditions such as bronchitis and sinusitis. When applied to the skin, menthol dilates the blood vessels, giving a sensation of coldness followed by an analgesic effect that relieves itching. It is therefore used in creams and ointments for the relief of pruritis and urticaria.",
"@language": "en",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_definition",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_76310"
],
"prov:wasDerivedFrom": "chebi.definition"
}
}
],
"@type": [
"https://w3id.org/chemrof/ImpreciseChemicalMixture"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works