Lithium Diisopropylazanide
fo-b6338f873b807ec3
Identity
- Type
- Molecular complex
- CAS
- 4111-54-0
- EC
- 223-893-0
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 54 across every transformer
Structure
Alternative labels
11- (Diisopropylamino)lithium
- 2-Propanamine, N-(1-methylethyl)-, lithium salt
- 2-Propanamine, N-(1-methylethyl)-, lithium salt (1:1)
- Diisopropylamine, lithium salt
- LDA (reagent)
- Lithiodiisopropylamine
- Lithium diisopropylamide
- Lithium diisopropylamine
- Lithium, (diisopropylamino)-
- N-(1-Methylethyl)-2-propanamine lithium salt
- N-Lithiodiisopropylamide
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | OVEHNNQXLPJPPL-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C6H15N.Li/c1-5(2)7-6(3)4;/h5-7H,1-4H3; |
| Molecular formula chemrof:molecular_formula | C6H15LiN |
| Molecular mass chemrof:molecular_mass | 108.134 |
| Monoisotopic mass chemrof:monoisotopic_mass | 108.136454 |
| SMILES string chemrof:smiles_string | [Li].CC(C)NC(C)C |
Known URLs
2Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=4111-54-0 | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/45051747 | enrich_references.pubchem_compound |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 02138d37-a76a-4802-a959-a030edea194f | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 239328a9-e15f-46cd-9c89-b3e153c36789 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| 959cc826-115c-487b-b34a-47902c9bf557 | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| 12f91570-a199-4cf6-b7c9-b0cc1631600b | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 20fd4c1c-9114-4cc4-bca4-4ea6c0f6ccc2 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| 253bce30-50e8-40cf-b3f9-0e7c46905793 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| 97cfe241-e2ae-4d50-af09-d93d1bb845d8 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| 8f31fefe-f73a-460d-97e7-424a3cac7274 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| c1af7397-4ef4-423c-b996-2de98e6d5124 | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| 3b63274b-c2cf-49ca-8207-8bc583f53a10 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 01320ef2-768f-4370-a4de-def7d80bb5b3 | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| 4c88a61a-0711-41de-a879-fc0a43fca7e4 | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| 3e144342-03f1-42e7-abca-ae4dffabac91 | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (54 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-b6338f873b807ec3",
"prefLabel": [
{
"@value": "Lithium Diisopropylazanide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "(Diisopropylamino)lithium",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Propanamine, N-(1-methylethyl)-, lithium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Propanamine, N-(1-methylethyl)-, lithium salt (1:1)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Diisopropylamine, lithium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "LDA (reagent)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lithiodiisopropylamine",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lithium diisopropylamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lithium diisopropylamine",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lithium, (diisopropylamino)-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "N-(1-Methylethyl)-2-propanamine lithium salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "N-Lithiodiisopropylamide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:4111-54-0",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C6H15LiN"
],
"attested_by": {
"C6H15LiN": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"OVEHNNQXLPJPPL-UHFFFAOYSA-N"
],
"attested_by": {
"OVEHNNQXLPJPPL-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"[Li].CC(C)NC(C)C"
],
"attested_by": {
"[Li].CC(C)NC(C)C": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C6H15N.Li/c1-5(2)7-6(3)4;/h5-7H,1-4H3;"
],
"attested_by": {
"InChI=1S/C6H15N.Li/c1-5(2)7-6(3)4;/h5-7H,1-4H3;": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
]
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
108.134
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
],
"attested_by": {
"108.134": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
108.136454
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[Li].CC(C)NC(C)C"
]
}
],
"attested_by": {
"108.136454": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=4111-54-0",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747;CAS:4111-54-0"
],
"prov:wasDerivedFrom": "pubchem.identifiers[4111-54-0]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/45051747",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051747;CAS:4111-54-0"
],
"prov:wasDerivedFrom": "pubchem.by_cas[4111-54-0]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "01320ef2-768f-4370-a4de-def7d80bb5b3",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "multi_component_neutral",
"reason": "",
"types": [
"https://w3id.org/chemrof/MolecularComplex"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.multi_component_neutral"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"4111-54-0"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=4111-54-0"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"223-893-0"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=223-893-0"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works