Bis(2-ethylhexyl) But-2-enedioate
fo-b79b70d008d0844c
Identity
- Type
- Neutral molecule
- CAS
- 141-02-6
- EC
- 205-448-2
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 55 across every transformer
Structure
This substance carries 2 candidate structures; the diagram is the first one RDKit could parse, not a settled answer.
Alternative labels
10- 2-Butenedioic acid (2E)-, 1,4-bis(2-ethylhexyl) ester
- 2-Butenedioic acid (2E)-, bis(2-ethylhexyl) ester
- 2-Butenedioic acid (E)-, bis(2-ethylhexyl) ester
- 2-Ethylhexyl fumarate
- Bis(2-ethylhexyl) fumarate
- Di-2-ethylhexyl fumarate
- Dioctyl fumarate
- Fumaric acid, bis(2-ethylhexyl) ester
- Maximol FOK 670
- RC Comonomer DOF
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | ROPXFXOUUANXRR-BUHFOSPRSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C20H36O4/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3/b14-13+ |
| Isomeric SMILES string chemrof:isomeric_smiles_string | CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC |
| IUPAC name chemrof:IUPAC_name | (E)-2-butenedioic acid bis(2-ethylhexyl) ester, (E)-but-2-enedioic acid bis(2-ethylhexyl) ester, bis(2-ethylhexyl) (E)-but-2-enedioate |
| Molecular formula chemrof:molecular_formula | C20H36O4 |
| Molecular mass chemrof:molecular_mass | 340.504 |
| Monoisotopic mass chemrof:monoisotopic_mass | 340.26136 |
| SMILES string chemrof:smiles_string | CCCCC(CC)COC(=O)C=CC(=O)OCC(CC)CCCC |
Known URLs
10Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 3bffbe64-99f1-4d99-b7ad-2354ae68c1a0 | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 4 |
| 7e818477-6d0a-4b59-9bf6-0af08984d366 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 4 |
| 1cef9329-399c-40ed-bf89-2bc020c7c590 | Environmental → Air → Indoor | EF 3.1 | kg | 4 |
| cafde9fc-64f4-4a2c-b521-1e01cae91cc3 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| ad75375e-6eef-41ad-bb42-62fddebc833b | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 4 |
| 66c96611-bcbc-4535-b218-f1730ef7f01a | Environmental → Air → Unknown | EF 3.1 | kg | 4 |
| 8a11a6c8-c6df-4a91-9a1a-801bc9039511 | Environmental → Ground → Agricultural | EF 3.1 | kg | 4 |
| 142bfd04-9187-4904-bcde-ac72ba50ea5f | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 4 |
| df115b9e-5954-410b-ae15-f9afc1aa0e5a | Environmental → Ground → Unknown | EF 3.1 | kg | 4 |
| 0cbed8ad-1c91-4649-9435-fb6ad67e669e | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 575fc6b1-04a6-4e22-9fc2-71d21c6eddd6 | Environmental → Water → Ocean | EF 3.1 | kg | 4 |
| d195ddb8-25c6-4d9e-9272-2770b5587ff2 | Environmental → Water → Surface water | EF 3.1 | kg | 4 |
| c5689df9-5244-415c-b638-9db6744cd4ba | Environmental → Water → Unknown | EF 3.1 | kg | 4 |
History
Everything that changed this substance (55 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-b79b70d008d0844c",
"prefLabel": [
{
"@value": "Bis(2-ethylhexyl) But-2-enedioate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "2-Butenedioic acid (2E)-, 1,4-bis(2-ethylhexyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Butenedioic acid (2E)-, bis(2-ethylhexyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Butenedioic acid (E)-, bis(2-ethylhexyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Ethylhexyl fumarate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bis(2-ethylhexyl) fumarate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Di-2-ethylhexyl fumarate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dioctyl fumarate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Fumaric acid, bis(2-ethylhexyl) ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Maximol FOK 670",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "RC Comonomer DOF",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:141-02-6",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C20H36O4"
],
"attested_by": {
"C20H36O4": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"ROPXFXOUUANXRR-BUHFOSPRSA-N"
],
"attested_by": {
"ROPXFXOUUANXRR-BUHFOSPRSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"CCCCC(CC)COC(=O)C=CC(=O)OCC(CC)CCCC"
],
"attested_by": {
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"CCCCC(CC)COC(=O)C=CC(=O)OCC(CC)CCCC": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
},
{
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
],
"prov:wasDerivedFrom": "smiles_string.stereochemistry_removed"
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C20H36O4/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3/b14-13+"
],
"attested_by": {
"InChI=1S/C20H36O4/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3/b14-13+": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"(E)-2-butenedioic acid bis(2-ethylhexyl) ester",
"(E)-but-2-enedioic acid bis(2-ethylhexyl) ester",
"bis(2-ethylhexyl) (E)-but-2-enedioate"
],
"attested_by": {
"(E)-2-butenedioic acid bis(2-ethylhexyl) ester": [
"enrich_references.pubchem_semantic"
],
"(E)-but-2-enedioic acid bis(2-ethylhexyl) ester": [
"enrich_references.pubchem_semantic"
],
"bis(2-ethylhexyl) (E)-but-2-enedioate": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
340.504
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
}
],
"attested_by": {
"340.504": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
340.26136
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
}
],
"attested_by": {
"340.26136": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/isomeric_smiles_string": {
"rdfs:label": "isomeric smiles string",
"@value": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
],
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC"
]
},
{
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "smiles_string"
}
]
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J3.497.979K",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J53.983J",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.004.954",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=141-02-6",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"141-02-6"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID2051710",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=163916",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6375",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/19Q90W09ES",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/5370325",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.by_cas[141-02-6]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q27252126",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5370325;CAS:141-02-6"
],
"prov:wasDerivedFrom": "pubchem.identifiers[141-02-6]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "0cbed8ad-1c91-4649-9435-fb6ad67e669e",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "neutral_molecule",
"reason": "",
"types": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.neutral_molecule"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"141-02-6"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=141-02-6"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"205-448-2"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=205-448-2"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works