Phosphonic Acid, Dibutyl Ester
fo-be0e4cfac00e3e90
Identity
- Type
- Neutral molecule
- CAS
- 1809-19-4
- EC
- 217-316-1
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 54 across every transformer
Structure
This substance carries 2 candidate structures; the diagram is the first one RDKit could parse, not a settled answer.
Alternative labels
12- Butyl alcohol, hydrogen phosphite
- Butyl phosphite ((C4H9O)2(HO)P)
- Butyl phosphonate ((BuO)2HPO)
- Butyl phosphonate ((C4H9O)2HPO)
- Di-n-butyl hydrogen phosphite
- Di-n-butyl phosphite
- Dibutoxyphosphine oxide
- Dibutyl hydrogen phosphite
- Dibutyl phosphite
- Dibutyl phosphonate
- Duraphos DBHP
- Phosphorous acid, dibutyl ester
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | BVXOPEOQUQWRHQ-UHFFFAOYSA-N, OSPSWZSRKYCQPF-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q+1, InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q-1 |
| IUPAC name chemrof:IUPAC_name | dibutoxy(keto)phosphonium, dibutoxy(oxidanylidene)phosphanium, dibutoxy(oxo)phosphanium, dibutoxy(oxo)phosphonium, dibutyl phosphite |
| Molecular formula chemrof:molecular_formula | C8H18O3P+, C8H18O3P- |
| SMILES string chemrof:smiles_string | CCCCOP([O-])OCCCC, CCCCO[P+](=O)OCCCC |
Known URLs
11Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=1809-19-4 | enrich_references.consensus_cas_link |
| chem.echa.europa.eu | https://chem.echa.europa.eu/100.015.742 | enrich_references.pubchem_identifier_url |
| comptox.epa.gov | https://comptox.epa.gov/dashboard/DTXSID0027438 | enrich_references.pubchem_identifier_url |
| dtp.cancer.gov | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2668 | enrich_references.pubchem_identifier_url |
| ebi.ac.uk | https://www.ebi.ac.uk/chembl/explore/compound/CHEMBL1901631 | enrich_references.pubchem_identifier_url |
| gsrs.ncats.nih.gov | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/R149712Z1F | enrich_references.pubchem_identifier_url |
| jglobal.jst.go.jp | http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J1.781G | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/23414612 | enrich_references.pubchem_compound |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/6327349 | enrich_references.pubchem_compound |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/erg/#1760 | enrich_references.pubchem_identifier_url |
| Wikidata | https://www.wikidata.org/wiki/Q126672947 | enrich_references.pubchem_identifier_url |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 63edf5f6-4314-4870-bf51-ea79c10d0fd1 | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 0961cb02-b018-44fd-9a79-b6052b1e4307 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| a872a93c-12da-4dd9-a9d7-3df4e540fc10 | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| d722352f-ff47-4375-a707-2534daee3229 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| b98574ef-a0d6-4916-9a03-a3890cd9d829 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| 6f895a2d-90a4-46f1-8921-20941fac8ce6 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| ae85d012-a608-4acf-a259-b618dc39a5e1 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| 6017010a-349f-4923-9502-ab22e2b81e83 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| 481cbbe7-6705-4574-af17-07383bdb0a4e | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| d39174f8-e47f-4643-aca3-25f85664d75b | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 0bbe8aac-a5b9-42c2-9237-ad19c06ee32f | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| d9369034-ea98-4ffe-887e-a221d460dfea | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| 72d81973-bf24-41f5-b069-c3b678dcaf64 | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (54 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-be0e4cfac00e3e90",
"prefLabel": [
{
"@value": "Phosphonic Acid, Dibutyl Ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "Butyl alcohol, hydrogen phosphite",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Butyl phosphite ((C4H9O)2(HO)P)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Butyl phosphonate ((BuO)2HPO)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Butyl phosphonate ((C4H9O)2HPO)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Di-n-butyl hydrogen phosphite",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Di-n-butyl phosphite",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dibutoxyphosphine oxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dibutyl hydrogen phosphite",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dibutyl phosphite",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dibutyl phosphonate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Duraphos DBHP",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphorous acid, dibutyl ester",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1809-19-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C8H18O3P+",
"C8H18O3P-"
],
"attested_by": {
"C8H18O3P+": [
"enrich_references.pubchem_semantic"
],
"C8H18O3P-": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349",
"CID:23414612"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCOP([O-])OCCCC"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"BVXOPEOQUQWRHQ-UHFFFAOYSA-N",
"OSPSWZSRKYCQPF-UHFFFAOYSA-N"
],
"attested_by": {
"BVXOPEOQUQWRHQ-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"OSPSWZSRKYCQPF-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349",
"CID:23414612"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCOP([O-])OCCCC"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"CCCCOP([O-])OCCCC",
"CCCCO[P+](=O)OCCCC"
],
"attested_by": {
"CCCCOP([O-])OCCCC": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"CCCCO[P+](=O)OCCCC": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349",
"CID:23414612"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCOP([O-])OCCCC"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q+1",
"InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q-1"
],
"attested_by": {
"InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q+1": [
"enrich_references.pubchem_semantic"
],
"InChI=1S/C8H18O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h3-8H2,1-2H3/q-1": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349",
"CID:23414612"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CCCCOP([O-])OCCCC"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"dibutoxy(keto)phosphonium",
"dibutoxy(oxidanylidene)phosphanium",
"dibutoxy(oxo)phosphanium",
"dibutoxy(oxo)phosphonium",
"dibutyl phosphite"
],
"attested_by": {
"dibutoxy(keto)phosphonium": [
"enrich_references.pubchem_semantic"
],
"dibutoxy(oxidanylidene)phosphanium": [
"enrich_references.pubchem_semantic"
],
"dibutoxy(oxo)phosphanium": [
"enrich_references.pubchem_semantic"
],
"dibutoxy(oxo)phosphonium": [
"enrich_references.pubchem_semantic"
],
"dibutyl phosphite": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349",
"CID:23414612"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J1.781G",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.015.742",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=1809-19-4",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"1809-19-4"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID0027438",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2668",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/R149712Z1F",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/23414612",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:23414612;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1809-19-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/6327349",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1809-19-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#1760",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://www.ebi.ac.uk/chembl/explore/compound/CHEMBL1901631",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q126672947",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6327349;CAS:1809-19-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1809-19-4]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "0961cb02-b018-44fd-9a79-b6052b1e4307",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "neutral_molecule",
"reason": "",
"types": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.neutral_molecule"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"1809-19-4"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=1809-19-4"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"217-316-1"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=217-316-1"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works