1,2-dichloropropane & 1,3-dichloropropene
fo-d6c9343d3b9f39b0
Identity
- Type
- Molecular complex
- CAS
- 8003-19-8
- EC
- —
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 51 across every transformer
Structure
Alternative labels
9- 1,2-Dichloropropane-1,3-dichloropropene mixt.
- 1-Propene, 1,3-dichloro-, mixt. with 1,2-dichloropropane
- D-D
- D-D (pesticide)
- D-D Soil Fumigant
- DD Nematocide
- Dowfume N
- Propane, 1,2-dichloro-, mixt. contg.
- Vidden D
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | FLWMCWWTXIAPAH-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C3H6Cl2.C3H4Cl2/c1-3(5)2-4;4-2-1-3-5/h3H,2H2,1H3;1-2H,3H2 |
| IUPAC name chemrof:IUPAC_name | 1,2-bis(chloranyl)propane;1,3-bis(chloranyl)prop-1-ene, 1,2-dichloropropane;1,3-dichloro-1-propene, 1,2-dichloropropane;1,3-dichloroprop-1-ene |
| Molecular formula chemrof:molecular_formula | C6H10Cl4 |
| Molecular mass chemrof:molecular_mass | 223.958 |
| Monoisotopic mass chemrof:monoisotopic_mass | 221.953661 |
| SMILES string chemrof:smiles_string | CC(CCl)Cl.C(C=CCl)Cl |
Known URLs
2Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=8003-19-8 | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/73422990 | enrich_references.pubchem_compound |
Elementary flows
15| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 9b3980d5-b897-4864-8e31-caa4549eeafb | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 8b9cbc15-3470-47b9-81fa-055edc9643a2 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| 22b7eb3d-5f10-4378-bf75-f1d4f30ad6af | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| ca3fd767-509d-4f49-899b-6c24deba0f02 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| 6b669626-f03a-4437-a81b-aeae1c0604d8 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| 06a8fd81-f88c-4981-8911-8722740900f3 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| dd594661-f117-409b-8781-70e8b400ac88 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| dc27e9af-efbb-4505-87ce-99e76612ff1c | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| 003eb490033e4b2f59eb9750fb4de929b89b321d | Environmental → Ground → Silvicultural | agribalyse algorithm addition | kg | 0 |
| 2ffdc62b-1c04-459d-9190-7c37450c2d23 | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| 3bf9faf3-04c1-4ecc-83d1-ef6d9686fb70 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| 88734497-3082-432c-be14-c1af52f28b4e | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| 159f25d69c7a0a5c4b3f85fef77c87dfe97bca30 | Environmental → Water → River | agribalyse algorithm addition | kg | 0 |
| f286569d-27c7-4a32-849f-16dd7ed39adf | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| e2d36f52-0b1f-45e5-942f-fe76e11f61b5 | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (51 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-d6c9343d3b9f39b0",
"prefLabel": [
{
"@value": "1,2-dichloropropane & 1,3-dichloropropene",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "1,2-Dichloropropane-1,3-dichloropropene mixt.",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1-Propene, 1,3-dichloro-, mixt. with 1,2-dichloropropane",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "D-D",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "D-D (pesticide)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "D-D Soil Fumigant",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "DD Nematocide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dowfume N",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propane, 1,2-dichloro-, mixt. contg.",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Vidden D",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:8003-19-8",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C6H10Cl4"
],
"attested_by": {
"C6H10Cl4": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"FLWMCWWTXIAPAH-UHFFFAOYSA-N"
],
"attested_by": {
"FLWMCWWTXIAPAH-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"CC(CCl)Cl.C(C=CCl)Cl"
],
"attested_by": {
"CC(CCl)Cl.C(C=CCl)Cl": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C3H6Cl2.C3H4Cl2/c1-3(5)2-4;4-2-1-3-5/h3H,2H2,1H3;1-2H,3H2"
],
"attested_by": {
"InChI=1S/C3H6Cl2.C3H4Cl2/c1-3(5)2-4;4-2-1-3-5/h3H,2H2,1H3;1-2H,3H2": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"1,2-bis(chloranyl)propane;1,3-bis(chloranyl)prop-1-ene",
"1,2-dichloropropane;1,3-dichloro-1-propene",
"1,2-dichloropropane;1,3-dichloroprop-1-ene"
],
"attested_by": {
"1,2-bis(chloranyl)propane;1,3-bis(chloranyl)prop-1-ene": [
"enrich_references.pubchem_semantic"
],
"1,2-dichloropropane;1,3-dichloro-1-propene": [
"enrich_references.pubchem_semantic"
],
"1,2-dichloropropane;1,3-dichloroprop-1-ene": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
223.958
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
],
"attested_by": {
"223.958": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
221.953661
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(CCl)Cl.C(C=CCl)Cl"
]
}
],
"attested_by": {
"221.953661": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=8003-19-8",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990;CAS:8003-19-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[8003-19-8]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/73422990",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:73422990;CAS:8003-19-8"
],
"prov:wasDerivedFrom": "pubchem.by_cas[8003-19-8]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "06a8fd81-f88c-4981-8911-8722740900f3",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "multi_component_neutral",
"reason": "",
"types": [
"https://w3id.org/chemrof/MolecularComplex"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.multi_component_neutral"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"8003-19-8"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=8003-19-8"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works