Nonabromo-1,1'-biphenyl
fo-d8e5f4e804d15952
Identity
- Type
- Neutral molecule
- CAS
- 27753-52-2
- EC
- 248-637-5
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 55 across every transformer
Structure
Alternative labels
5- 1,1′-Biphenyl, nonabromo-
- Biphenyl, nonabromo-
- Bromkal 80-9D
- Nonabromo-1,1′-biphenyl
- Nonabromobiphenyl
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | LWICCBMIAPTSTO-UHFFFAOYSA-N, QLERKXRXNDBTDM-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C12HBr9/c13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17/h1H |
| IUPAC name chemrof:IUPAC_name | Nonabromo-1,1'-biphenyl |
| Molecular formula chemrof:molecular_formula | C12HBr9 |
| SMILES string chemrof:smiles_string | Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br |
Known URLs
6Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=27753-52-2 | enrich_references.pubchem_identifier_url |
| chem.echa.europa.eu | https://chem.echa.europa.eu/100.044.200 | enrich_references.pubchem_identifier_url |
| comptox.epa.gov | https://comptox.epa.gov/dashboard/DTXSID40873533 | enrich_references.pubchem_identifier_url |
| gsrs.ncats.nih.gov | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/30D27AGQ16 | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/34004 | enrich_references.pubchem_compound |
| Wikidata | https://www.wikidata.org/wiki/Q27255943 | enrich_references.pubchem_identifier_url |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 369e96c4-0bbb-4ef5-9e8f-258ac83f7efe | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 2 |
| 1b75e108-6da0-4649-bfec-d8702cb7828a | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 2 |
| d5ec217c-121e-4ddd-affc-27489f49c3fc | Environmental → Air → Indoor | EF 3.1 | kg | 2 |
| 010b2f24-d5cf-44a9-b637-98f48c76ee30 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| d5182928-9555-4c1c-8ba8-cf21d001b9d8 | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 2 |
| 35bbe3cb-9738-4b2e-b8c8-e25bc9a669c5 | Environmental → Air → Unknown | EF 3.1 | kg | 2 |
| 37cea445-c7d1-4ab5-a169-ccc9083e39b6 | Environmental → Ground → Agricultural | EF 3.1 | kg | 2 |
| 10f66e2b-a8dd-47b6-8db6-7c7a32537d58 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 2 |
| 556e094f-8020-4eb0-8361-787886127fa3 | Environmental → Ground → Unknown | EF 3.1 | kg | 2 |
| 5f067330-c09d-4818-b633-d6a7be8bf537 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| fe6dc885-b562-48b8-9c57-6c0b8c59149c | Environmental → Water → Ocean | EF 3.1 | kg | 2 |
| fac3f4f6-7e74-473c-9f6e-b03bcf108a86 | Environmental → Water → Surface water | EF 3.1 | kg | 2 |
| 08d9bcbe-f891-4cc6-be05-89b8bcf2990a | Environmental → Water → Unknown | EF 3.1 | kg | 2 |
History
Everything that changed this substance (55 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-d8e5f4e804d15952",
"prefLabel": [
{
"@value": "Nonabromo-1,1'-biphenyl",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "1,1′-Biphenyl, nonabromo-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:27753-52-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Biphenyl, nonabromo-",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:27753-52-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromkal 80-9D",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:27753-52-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Nonabromo-1,1′-biphenyl",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:27753-52-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Nonabromobiphenyl",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:27753-52-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C12HBr9"
],
"attested_by": {
"C12HBr9": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"LWICCBMIAPTSTO-UHFFFAOYSA-N",
"QLERKXRXNDBTDM-UHFFFAOYSA-N"
],
"attested_by": {
"LWICCBMIAPTSTO-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"QLERKXRXNDBTDM-UHFFFAOYSA-N": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Nonabromo-1,1'-biphenyl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br"
]
}
],
"attested_by": {
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C12HBr9/c13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17/h1H"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Nonabromo-1,1'-biphenyl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Brc1cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br"
]
}
],
"attested_by": {
"InChI=1S/C12HBr9/c13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17/h1H": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Nonabromo-1,1'-biphenyl"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Nonabromo-1,1'-biphenyl"
]
},
"attested_by": {
"Nonabromo-1,1'-biphenyl": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "https://chem.echa.europa.eu/100.044.200",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[27753-52-2]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=27753-52-2",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[27753-52-2]"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID40873533",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[27753-52-2]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/30D27AGQ16",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[27753-52-2]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/34004",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.by_cas[27753-52-2]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q27255943",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:34004;CAS:27753-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[27753-52-2]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "010b2f24-d5cf-44a9-b637-98f48c76ee30",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "neutral_molecule",
"reason": "",
"types": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:wasDerivedFrom": "semantic_typing.rule.neutral_molecule"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"27753-52-2"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=27753-52-2"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"248-637-5"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=248-637-5"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
]
}
Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works