Glycerol, Propoxylated, Esters With Acrylic Acid
119d4046-06a8-4567-8b2d-1b55a0c3f410
Identity
- Substance
- fo-89bf0c8031830af7 Molecular complex
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Ground level → Urban (>1000 people/square mile)
- CAS
- 52408-84-1
- EC
- 500-114-5
Context
- Dimension
- Environmental
- Media
- Air
- Population density
- Urban (>1000 people/square mile)
- Strata
- Ground level
Alternative labels
27- Crodamer UVM 35
- EM 2387TF
- Ebecryl 53
- Ebecryl OTA 480
- Etermer EM 2384
- G 3.5POTA
- GPTA
- Genorad 20
- Glycerol propoxylate triacrylate
- Laromer GPTA
- Miramer M 320
- Nanocryl C 155
- Poly[oxy(methyl-1,2-ethanediyl)], α,α′,α′′-1,2,3-propanetriyltris[ω-[(1-oxo-2-propen-1-yl)oxy]-
- Poly[oxy(methyl-1,2-ethanediyl)], α,α′,α′′-1,2,3-propanetriyltris[ω-[(1-oxo-2-propenyl)oxy]-
- Polypropylene glycol glycerol ether triacrylate
- Polypropylene glycol-glycerin ether triacrylate
- Propoxylated glycerin triacrylate
- Propoxylated glycerol triacrylate
- Propoxylated glycerol triacrylate copolymer
- Propoxylated glyceryl triacrylate
- Reasoap SR 2090
- SR 9020HP
- SR 9092NS
- Sartomer SR 9021
- Tripropylene glycol triacrylate
- Viscoat GPT
- α,α′,α′′-1,2,3-Propanetriyltris[polypropylene glycol acrylate]
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | 119d4046-06a8-4567-8b2d-1b55a0c3f410 | glycerol, propoxylated, esters with acrylic acid | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | 119d4046-06a8-4567-8b2d-1b55a0c3f410 | glycerol, propoxylated, esters with acrylic acid | Emissions/Emissions to air/Emissions to urban air close to ground | exactMatch | — |
Characterisation factors
8- consensus-flow-list 4
- European Commission — JRC 4
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 105.72 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 105.72 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 105.72 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 105.72 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, non-cancer | — | 1.7226e-07 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, non-cancer | — | 1.7226e-07 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, non-cancer_organics | — | 1.7226e-07 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, non-cancer_organics | — | 1.7226e-07 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "Crodamer UVM 35",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "EM 2387TF",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ebecryl 53",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ebecryl OTA 480",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Etermer EM 2384",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "G 3.5POTA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "GPTA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Genorad 20",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Glycerol propoxylate triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Laromer GPTA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Miramer M 320",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Nanocryl C 155",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Poly[oxy(methyl-1,2-ethanediyl)], α,α′,α′′-1,2,3-propanetriyltris[ω-[(1-oxo-2-propen-1-yl)oxy]-",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Poly[oxy(methyl-1,2-ethanediyl)], α,α′,α′′-1,2,3-propanetriyltris[ω-[(1-oxo-2-propenyl)oxy]-",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Polypropylene glycol glycerol ether triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Polypropylene glycol-glycerin ether triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propoxylated glycerin triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propoxylated glycerol triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propoxylated glycerol triacrylate copolymer",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propoxylated glyceryl triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Reasoap SR 2090",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SR 9020HP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SR 9092NS",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sartomer SR 9021",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tripropylene glycol triacrylate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Viscoat GPT",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "α,α′,α′′-1,2,3-Propanetriyltris[polypropylene glycol acrylate]",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:52408-84-1",
"https://commonchemistry.cas.org/detail?cas_rn=52408-84-1"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C15H20O6",
"C18H32O10",
"C21H32O9",
"C23H36O9",
"C9H20O7"
],
"attested_by": {
"C15H20O6": [
"enrich_references.pubchem_semantic"
],
"C21H32O9": [
"enrich_references.pubchem_semantic"
],
"C23H36O9": [
"enrich_references.pubchem_semantic"
],
"C9H20O7": [
"enrich_references.pubchem_semantic"
],
"C18H32O10": [
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892",
"CID:93276",
"CID:16212662",
"CID:154824818"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"DMQYPVOQAARSNF-UHFFFAOYSA-N",
"JEERAJONXJPTPM-UHFFFAOYSA-N",
"JNFPXISXWCEVPL-UHFFFAOYSA-N",
"NEBBLNDVSSWJLL-UHFFFAOYSA-N",
"UBYAUQUDABJKQI-UHFFFAOYSA-N"
],
"attested_by": {
"DMQYPVOQAARSNF-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"JEERAJONXJPTPM-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"NEBBLNDVSSWJLL-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"UBYAUQUDABJKQI-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"JNFPXISXWCEVPL-UHFFFAOYSA-N": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892",
"CID:93276",
"CID:16212662",
"CID:154824818"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tripropylene glycol triacrylate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO"
]
}
],
"attested_by": {
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C9H20O4.3C3H4O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;3*1-2-3(4)5/h7-11H,4-6H2,1-3H3;3*2H,1H2,(H,4,5)"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tripropylene glycol triacrylate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CC(O)COC(C)COC(C)CO"
]
}
],
"attested_by": {
"InChI=1S/C9H20O4.3C3H4O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;3*1-2-3(4)5/h7-11H,4-6H2,1-3H3;3*2H,1H2,(H,4,5)": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Tripropylene glycol triacrylate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Tripropylene glycol triacrylate"
]
},
"attested_by": {
"Tripropylene glycol triacrylate": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J25.615C",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J875.380F",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:93276;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.028.186",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=52408-84-1",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"52408-84-1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=59822-79-6",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=7401-88-9",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID10995312",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID20921288",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:93276;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=24176",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/154824818",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:154824818;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.by_cas[52408-84-1]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/16212662",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:16212662;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.by_cas[52408-84-1]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/81892",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.by_cas[52408-84-1]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/93276",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:93276;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.by_cas[52408-84-1]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q72480603",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:93276;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q82894092",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:93276;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q82986670",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:81892;CAS:52408-84-1"
],
"prov:wasDerivedFrom": "pubchem.identifiers[52408-84-1]"
}
}
],
"prefLabel": [
{
"@value": "Glycerol, Propoxylated, Esters With Acrylic Acid",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "119d4046-06a8-4567-8b2d-1b55a0c3f410",
"identifier": "119d4046-06a8-4567-8b2d-1b55a0c3f410",
"source": "EF 3.1",
"cas_numbers": [
"52408-84-1"
],
"ec_numbers": [
"500-114-5"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Ground level",
"population_density": "Urban (>1000 people/square mile)"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 105.72
},
{
"method_uuid": "7cfdcfcf-b222-4b26-888a-a55f9fbf7ac8",
"name": "Human toxicity, non-cancer",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 1.7226e-7
},
{
"method_uuid": "8c3141e9-1f15-43b5-bff2-182e49893a46",
"name": "Human toxicity, non-cancer_organics",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 1.7226e-7
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 105.72
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-grle-ur10pesq",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-89bf0c8031830af7",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/119d4046-06a8-4567-8b2d-1b55a0c3f410",
"skos:prefLabel": "glycerol, propoxylated, esters with acrylic acid",
"context": "Emissions/Emissions to air/Emissions to urban air close to ground",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/119d4046-06a8-4567-8b2d-1b55a0c3f410"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/119d4046-06a8-4567-8b2d-1b55a0c3f410"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"52408-84-1": "exactMatch"
},
"_transformed": true,
"_provided": {
"name": "glycerol, propoxylated, esters with acrylic acid",
"synonyms": [
"organic",
"glycerol,propoxylated,esterswithacrylicacid",
"glycerol,propoxylated,esterswithacrylicacid1-6.5molespropoxylated",
"agisyn2837",
"chemspec:3,8-po",
"chint:acrylic(glycerol+3,8po)trie",
"etermer2384",
"etermer2384tf",
"etermer2387",
"etermer2387-tf",
"laromergpta",
"miramerm320",
"phaseireachkandidat",
"qualicuregm63x00(gpta)"
],
"context": [
"Emissions",
"Emissions to air",
"Emissions to urban air close to ground"
],
"cas_numbers": [
"52408-84-1"
],
"ec_numbers": [
"500-114-5"
],
"unit": "kg"
}
}
Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works