Brightway Flows 1.0
GitHub

Identity

Substance
fo-d9134afb3af4fcfd Chemical salt
Source
EF 3.1
Unit
kg
Context
Environmental → Water → Long-term
CAS
140-89-6
EC
205-439-3

Context

Dimension
Environmental
Media
Water
Water body
Long-term

Alternative labels

19

Source lists

1
List Version Source flow Name there Why this flow
EF 3.1 2f2c743b-36bb-43d5-bdd1-e5c56156460e potassium O-ethyl dithiocarbonate The consensus list is built from this one, so this row is the flow itself rather than something matched to it.

Concept associations

1
Source list Source flow Name there Compartment there Match Conversion
EF 3.1 2f2c743b-36bb-43d5-bdd1-e5c56156460e potassium O-ethyl dithiocarbonate Emissions/Emissions to water/Emissions to water, unspecified (long-term) exactMatch

Characterisation factors

8

Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.

Method Implementation Category Place Factor Published as
EF 3.1 European Commission — JRC Ecotoxicity, freshwater 0
EF 3.1 consensus-flow-list Ecotoxicity, freshwater 0 sole
EF 3.1 European Commission — JRC Ecotoxicity, freshwater_organics 0
EF 3.1 consensus-flow-list Ecotoxicity, freshwater_organics 0 sole
EF 3.1 European Commission — JRC Human toxicity, non-cancer 0
EF 3.1 consensus-flow-list Human toxicity, non-cancer 0 sole
EF 3.1 European Commission — JRC Human toxicity, non-cancer_organics 0
EF 3.1 consensus-flow-list Human toxicity, non-cancer_organics 0 sole

This flow in the difference report

History

The change log and the PROV-O trail (2 consensus changes)

Open the changes page

These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.

Full record

Flow JSON
{
  "altLabel": [
    {
      "@value": "(O-Ethyl dithiocarbonato)potassium",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "O-Ethyl dithiocarbonate potassium salt",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "O-Ethyl potassium dithiocarbonate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "BKs",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "BKs (flotation agent)",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbonic acid, dithio-, O-ethyl ester, potassium salt",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbonodithioic acid, O-ethyl ester, potassium salt",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbonodithioic acid, O-ethyl ester, potassium salt (1:1)",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Dithiocarbonic acid O-ethyl ester potassium salt",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Ethoxymethanedithioic acid potassium",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Ethyl potassium xanthate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Ethyl potassium xanthogenate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Ethylxanthic acid potassium salt",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "KEX",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Potassium O-ethyl carbonodithioate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Potassium ethylxanthate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Potassium ethylxanthogenate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Potassium xanthate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Potassium xanthogenate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CAS:140-89-6",
          "https://commonchemistry.cas.org/detail?cas_rn=140-89-6"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    }
  ],
  "properties": {
    "https://w3id.org/chemrof/molecular_formula": {
      "@id": "https://w3id.org/chemrof/molecular_formula",
      "@value": [
        "C3H5KOS2",
        "C3H6KOS2"
      ],
      "attested_by": {
        "C3H6KOS2": [
          "enrich_references.pubchem_semantic"
        ],
        "C3H5KOS2": [
          "rdkit_post_consensus"
        ]
      },
      "rdfs:label": "Molecular formula",
      "provenance": [
        {
          "prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CID:45051758"
          ],
          "prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CCOC(=S)[S-].[K+]"
          ]
        }
      ]
    },
    "https://w3id.org/chemrof/inchi2d_key_string": {
      "@id": "https://w3id.org/chemrof/inchi2d_key_string",
      "@value": [
        "JCBJVAJGLKENNC-UHFFFAOYSA-M",
        "LBLHPKUSAXGNRG-UHFFFAOYSA-N"
      ],
      "attested_by": {
        "LBLHPKUSAXGNRG-UHFFFAOYSA-N": [
          "enrich_references.pubchem_semantic"
        ],
        "JCBJVAJGLKENNC-UHFFFAOYSA-M": [
          "rdkit_post_consensus"
        ]
      },
      "rdfs:label": "InChIKey",
      "provenance": [
        {
          "prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CID:45051758"
          ],
          "prov:wasDerivedFrom": "pubchem.props.InChIKey"
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CCOC(=S)[S-].[K+]"
          ]
        }
      ]
    },
    "https://w3id.org/chemrof/smiles_string": {
      "@id": "https://w3id.org/chemrof/smiles_string",
      "rdfs:label": "SMILES",
      "@value": [
        "CCOC(=S)[S-].[K+]"
      ],
      "provenance": [
        {
          "prov:wasGeneratedBy": "opsin_iupac",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "Potassium O-ethyl Dithiocarbonate"
          ]
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CCOC(=S)[S-].[K+]"
          ]
        }
      ],
      "attested_by": {
        "CCOC(=S)[S-].[K+]": [
          "opsin_iupac",
          "rdkit_post_consensus"
        ]
      }
    },
    "https://w3id.org/chemrof/inchi2d_string": {
      "@id": "https://w3id.org/chemrof/inchi2d_string",
      "rdfs:label": "InChI",
      "@value": [
        "InChI=1S/C3H6OS2.K/c1-2-4-3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1"
      ],
      "provenance": [
        {
          "prov:wasGeneratedBy": "opsin_iupac",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "Potassium O-ethyl Dithiocarbonate"
          ]
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "consensus-flow-list",
          "prov:hadPrimarySource": [
            "CCOC(=S)[S-].[K+]"
          ]
        }
      ],
      "attested_by": {
        "InChI=1S/C3H6OS2.K/c1-2-4-3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1": [
          "opsin_iupac",
          "rdkit_post_consensus"
        ]
      }
    },
    "https://w3id.org/chemrof/IUPAC_name": {
      "@id": "https://w3id.org/chemrof/IUPAC_name",
      "rdfs:label": "IUPAC name",
      "@value": [
        "Potassium O-ethyl Dithiocarbonate"
      ],
      "provenance": {
        "prov:wasGeneratedBy": "opsin_iupac",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "Potassium O-ethyl Dithiocarbonate"
        ]
      },
      "attested_by": {
        "Potassium O-ethyl Dithiocarbonate": [
          "opsin_iupac"
        ]
      }
    }
  },
  "references": [
    {
      "@id": "https://commonchemistry.cas.org/detail?cas_rn=140-89-6",
      "provenance": {
        "prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CID:45051758;CAS:140-89-6"
        ],
        "prov:wasDerivedFrom": "pubchem.identifiers[140-89-6]"
      }
    },
    {
      "@id": "https://pubchem.ncbi.nlm.nih.gov/compound/45051758",
      "provenance": {
        "prov:wasGeneratedBy": "enrich_references.pubchem_compound",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "CID:45051758;CAS:140-89-6"
        ],
        "prov:wasDerivedFrom": "pubchem.by_cas[140-89-6]"
      }
    }
  ],
  "prefLabel": [
    {
      "@value": "Potassium O-ethyl Dithiocarbonate",
      "@language": "en",
      "source": {
        "prov:wasGeneratedBy": "bootstrap_labels",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "EF 3.1"
        ],
        "prov:wasDerivedFrom": "legacy name field"
      }
    }
  ],
  "@type": [
    "https://w3id.org/chemrof/ChemicalSalt"
  ],
  "http://www.w3.org/2004/02/skos/core#definition": [],
  "uuid": "2f2c743b-36bb-43d5-bdd1-e5c56156460e",
  "identifier": "2f2c743b-36bb-43d5-bdd1-e5c56156460e",
  "source": "EF 3.1",
  "cas_numbers": [
    "140-89-6"
  ],
  "ec_numbers": [
    "205-439-3"
  ],
  "context": {
    "dimension": "Environmental",
    "media": "Water",
    "water_body": "Long-term"
  },
  "synonyms": [],
  "lcia_methods": [
    {
      "method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
      "name": "Ecotoxicity, freshwater",
      "methodology": "Environmental Footprint",
      "impact_category": "Aquatic eco-toxicity",
      "impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
      "characterization_factor": 0.0
    },
    {
      "method_uuid": "7cfdcfcf-b222-4b26-888a-a55f9fbf7ac8",
      "name": "Human toxicity, non-cancer",
      "methodology": "Environmental Footprint",
      "impact_category": "Non-cancer human health effects",
      "impact_indicator": "Comparative Toxic Unit for human (CTUh)",
      "characterization_factor": 0.0
    },
    {
      "method_uuid": "8c3141e9-1f15-43b5-bff2-182e49893a46",
      "name": "Human toxicity, non-cancer_organics",
      "methodology": "Environmental Footprint",
      "impact_category": "Non-cancer human health effects",
      "impact_indicator": "Comparative Toxic Unit for human (CTUh)",
      "characterization_factor": 0.0
    },
    {
      "method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
      "name": "Ecotoxicity, freshwater_organics",
      "methodology": "Environmental Footprint",
      "impact_category": "Aquatic eco-toxicity",
      "impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
      "characterization_factor": 0.0
    }
  ],
  "unit": "kg",
  "input_datasets": [
    "EF 3.1"
  ],
  "context_iri": "https://vocab.brightway.one/flow-contexts/envi-wate-lote",
  "unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
  "flow_object_id": "fo-d9134afb3af4fcfd",
  "concept_associations": [
    {
      "@type": "xkos:ConceptAssociation",
      "xkos:sourceConcept": {
        "@id": "https://vocab.brightway.one/ef/3.1/flow/2f2c743b-36bb-43d5-bdd1-e5c56156460e",
        "skos:prefLabel": "potassium O-ethyl dithiocarbonate",
        "context": "Emissions/Emissions to water/Emissions to water, unspecified (long-term)",
        "qudt:hasUnit": {
          "@id": "https://vocab.brightway.one/units/unit/KiloGM"
        },
        "skos:exactMatch": {
          "@id": "https://vocab.brightway.dev/elementary-flows/2f2c743b-36bb-43d5-bdd1-e5c56156460e"
        }
      },
      "xkos:targetConcept": {
        "@id": "https://vocab.brightway.dev/elementary-flows/2f2c743b-36bb-43d5-bdd1-e5c56156460e"
      },
      "provenance": {
        "prov:wasGeneratedBy": "build_concept_associations",
        "prov:wasAttributedTo": "consensus-flow-list",
        "prov:hadPrimarySource": [
          "https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
        ]
      }
    }
  ],
  "_sources": {
    "prefLabel": "normalize_name_case",
    "name": "bootstrap_labels",
    "synonyms": "bootstrap_labels",
    "context": "default_context_mapping",
    "context_iri": "default_context_mapping",
    "unit_iri": "unit_normalization",
    "properties": "withhold_ambiguous_mass",
    "skos_definition": "enrich_references",
    "references": "enrich_references",
    "altLabel": "strip_catalogue_altlabels",
    "cas_match_labels": "consensus_match",
    "concept_associations": "carry_associations_onto_flows",
    "types": "link_flows_to_their_substance"
  },
  "cas_match_labels": {
    "140-89-6": "exactMatch"
  },
  "_transformed": true,
  "_provided": {
    "name": "potassium O-ethyl dithiocarbonate",
    "synonyms": [
      "(O-Ethyl dithiocarbonato)potassium",
      "AB1002584",
      "AC1MC2HE",
      "AC1Q1TZG",
      "AC1Q35E2",
      "Carbonic acid, dithio-, O-ethyl ester, potassium salt",
      "Carbonodithioic acid, O-ethyl ester, potassium salt",
      "Carbonodithioic acid, O-ethyl ester, potassium salt (1:1)",
      "E0194",
      "Ethyl potassium xanthate",
      "Ethyl potassium xanthogenate",
      "Ethylxanthic acid potassium salt",
      "FT-0083181",
      "I09-0970",
      "O-Ethyl potassium dithiocarbonate",
      "O-Ethylxanthic acid potassium salt",
      "OR59885",
      "PEK",
      "POTASSIUM ETHYLXANTHATE",
      "Potassium ethyl dithiocarbonate",
      "Potassium ethyl xanthate",
      "Potassium ethyl xanthogenate",
      "Potassium ethylxanthogenate",
      "Potassium xanthate",
      "Potassium xanthogenate",
      "ST011773",
      "STOCK1S-54053",
      "Xanthic acid, ethyl-, potassium salt",
      "Z 3 (Pesticide)",
      "Z 3 (VAN)",
      "Z3",
      "[(ethoxymethanethioyl)sulfanyl]potassium",
      "ethylxanthic acid, potassium salt",
      "ethylxanthic acidpotassiumsalt",
      "kalium-o-ethyldithiocarbonat",
      "o ethyl xanthic acid, potassium salt",
      "potassium ethoxymethanedithioate",
      "potassium o-ethyl carbonodithioate",
      "potassium-o-ethyldithiocarbonate",
      "potassiumethyl xanthate"
    ],
    "context": [
      "Emissions",
      "Emissions to water",
      "Emissions to water, unspecified (long-term)"
    ],
    "cas_numbers": [
      "140-89-6"
    ],
    "ec_numbers": [
      "205-439-3"
    ],
    "unit": "kg"
  }
}

Something wrong here?

A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.

You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works

Keyboard

?
Show or hide this map
/
Focus search
Esc
Close