Tris(methylphenyl) Phosphate
41cc1052-ff1c-4c10-8843-13373cc5197f
Identity
- Substance
- fo-06574d9e224fb032 Neutral molecule
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Water → Ocean
- CAS
- 1330-78-5
- EC
- 215-548-8, 809-930-9
Context
- Dimension
- Environmental
- Media
- Water
- Water body
- Ocean
Alternative labels
28- Cresyl phosphate
- Disflamoll TKP
- Disflamoll TKP-P
- Durad TCP
- Imol S 140
- Kronitex
- Kronitex R
- Kronitex TCP
- Lindol
- Lindol XP Plus
- MeSH ID: D014317
- Nissan Unflame TCP
- Phosflex TCP
- Phosphoric acid tricresyl ester
- Phosphoric acid, tris(methylphenyl) ester
- Phosphoric acid, tritolyl ester
- Reomol TCP
- Sansocizer TCP
- Sumiguard TBT
- Syn-O-Ad 8484
- TCF
- TCP
- Tricresol phosphate
- Tricresyl orthophosphate
- Tricresyl phosphate
- Tris(tolyloxy)phosphine oxide
- Tritolyl phosphate
- WSFR-TCP
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | 41cc1052-ff1c-4c10-8843-13373cc5197f | tris(methylphenyl) phosphate | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | 41cc1052-ff1c-4c10-8843-13373cc5197f | tris(methylphenyl) phosphate | Emissions/Emissions to water/Emissions to sea water | exactMatch | — |
Characterisation factors
8- consensus-flow-list 4 (2 non-zero)
- European Commission — JRC 4 (2 non-zero)
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 0.27013 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 0.27013 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 0.27013 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 0.27013 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, cancer | — | 0 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, cancer | — | 0 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, cancer_organics | — | 0 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, cancer_organics | — | 0 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "Cresyl phosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Disflamoll TKP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Disflamoll TKP-P",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Durad TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Imol S 140",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Kronitex",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Kronitex R",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Kronitex TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lindol",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lindol XP Plus",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "MeSH ID: D014317",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Nissan Unflame TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosflex TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphoric acid tricresyl ester",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphoric acid, tris(methylphenyl) ester",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phosphoric acid, tritolyl ester",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Reomol TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sansocizer TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sumiguard TBT",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Syn-O-Ad 8484",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "TCF",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tricresol phosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tricresyl orthophosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tricresyl phosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tris(tolyloxy)phosphine oxide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tritolyl phosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "WSFR-TCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:1330-78-5",
"https://commonchemistry.cas.org/detail?cas_rn=1330-78-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C21H21O4P",
"C21H21O7P",
"C63H63O12P3",
"C84H84O16P4"
],
"attested_by": {
"C21H21O4P": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"C21H21O7P": [
"enrich_references.pubchem_semantic"
],
"C63H63O12P3": [
"enrich_references.pubchem_semantic"
],
"C84H84O16P4": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529",
"CID:44630431",
"CID:57501505",
"CID:76961998"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"BOSMZFBHAYFUBJ-UHFFFAOYSA-N",
"IUJIYUAKFBGBCG-UHFFFAOYSA-N",
"JUNVZZCUBCDWAE-UHFFFAOYSA-N",
"JVHMUUUYNIPCPF-UHFFFAOYSA-N"
],
"attested_by": {
"BOSMZFBHAYFUBJ-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"IUJIYUAKFBGBCG-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"JUNVZZCUBCDWAE-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"JVHMUUUYNIPCPF-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529",
"CID:44630431",
"CID:57501505",
"CID:76961998"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Phosphoric acid tricresyl ester"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1"
]
}
],
"attested_by": {
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C21H21O4P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h4-15H,1-3H3"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Phosphoric acid tricresyl ester"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1"
]
}
],
"attested_by": {
"InChI=1S/C21H21O4P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h4-15H,1-3H3": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Phosphoric acid tricresyl ester"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Phosphoric acid tricresyl ester"
]
},
"attested_by": {
"Phosphoric acid tricresyl ester": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J1.952F",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.001.005",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.014.136",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:76961998;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.239.100",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:76961998;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=1330-78-5",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID5052676",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2181",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://en.wikipedia.org/wiki/Tricresyl_phosphate",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/5149JKD098",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://hmdb.ca/metabolites/HMDB0259136",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/44630431",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:44630431;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/57501505",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:57501505;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/6529",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/76961998",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:76961998;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.by_cas[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#2574",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#3082",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://www.ebi.ac.uk/chembl/explore/compound/CHEMBL1596847",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q26840796",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:6529;CAS:1330-78-5"
],
"prov:wasDerivedFrom": "pubchem.identifiers[1330-78-5]"
}
}
],
"prefLabel": [
{
"@value": "Tris(methylphenyl) Phosphate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "41cc1052-ff1c-4c10-8843-13373cc5197f",
"identifier": "41cc1052-ff1c-4c10-8843-13373cc5197f",
"source": "EF 3.1",
"cas_numbers": [
"1330-78-5"
],
"ec_numbers": [
"809-930-9",
"215-548-8"
],
"context": {
"dimension": "Environmental",
"media": "Water",
"water_body": "Ocean"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.27013
},
{
"method_uuid": "2299222a-bbd8-474f-9d4f-4dd1f18aea7c",
"name": "Human toxicity, cancer",
"methodology": "Environmental Footprint",
"impact_category": "Cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh) ",
"characterization_factor": 0.0
},
{
"method_uuid": "503699e0-eca9-4089-8bf8-e0f49c93e578",
"name": "Human toxicity, cancer_organics",
"methodology": "Environmental Footprint",
"impact_category": "Cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh) ",
"characterization_factor": 0.0
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.27013
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-wate-ocea",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-06574d9e224fb032",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/41cc1052-ff1c-4c10-8843-13373cc5197f",
"skos:prefLabel": "tris(methylphenyl) phosphate",
"context": "Emissions/Emissions to water/Emissions to sea water",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/41cc1052-ff1c-4c10-8843-13373cc5197f"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/41cc1052-ff1c-4c10-8843-13373cc5197f"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"ec_numbers": "ec_cross_check",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"1330-78-5": "exactMatch"
},
"_transformed": true,
"_provided": {
"name": "tris(methylphenyl) phosphate",
"synonyms": [
"AC1L1MQA",
"AC1Q2MYY",
"AC1Q6SIH",
"BBL000008",
"Celluflex 179C",
"Cresyl phosphate",
"Disflamoll TKP",
"Durad",
"Flexol Plasticizer TCP",
"Fyrquel 150",
"I14-1192",
"IMOL S 140",
"Imol S-140",
"Kronitex",
"Lindol",
"NCI-C61041",
"PX-917",
"Phosflex 179A",
"Phosphoric Acid Tri-p-cresyl Ester",
"Phosphoric Acid Tri-p-tolyl Ester",
"Phosphoric acid tris(methylphenyl) ester",
"Phosphoric acid tris(methylphenyl) ester",
"Phosphoric acid, tolyl ester",
"Phosphoric acid, tri(4-tolyl)ester",
"Phosphoric acid, tri-p-tolyl ester",
"Phosphoric acid, tri-p-tolyl ester (8CI)",
"Phosphoric acid, tris(4-methylphenyl) ester",
"Phosphoric acid, tris(methylphenyl) ester",
"Phosphoric acid, tritolyl ester",
"T3540",
"TPC",
"TRI-P-CRESYL PHOSPHATE",
"Thiorthocresyl phosphate",
"Tolylphosphate",
"Tpcp",
"Tri-p-tolyl phosphate",
"Tricresyl phosphate (Tritolyl phosphate)",
"Tricresyl phosphates",
"Tris(4-methylphenyl) phosphate",
"Tris(tolyloxy)phosphine oxide",
"Union carbide flexo l TCP",
"Union carbide flexol TCP",
"p-Tolyl phosphate ((C7H7O)3PO)",
"tris(methylphenyl)ester of phosphoric acid"
],
"context": [
"Emissions",
"Emissions to water",
"Emissions to sea water"
],
"cas_numbers": [
"1330-78-5"
],
"ec_numbers": [
"809-930-9"
],
"unit": "kg"
}
}
Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works