MCPA-sodium
a0d2e659-6afe-4e4e-bdfe-3241197ebb49
Identity
- Substance
- fo-412588dc22ccf36a Chemical salt
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Ground level → Urban (>1000 people/square mile)
- CAS
- 3653-48-3
- EC
- 222-895-9
Context
- Dimension
- Environmental
- Media
- Air
- Population density
- Urban (>1000 people/square mile)
- Strata
- Ground level
Alternative labels
40- (p-Chloro-o-tolyloxy)acetic acid sodium salt
- 2-Methyl-4-chlorophenoxyacetic acid sodium salt
- 2M-4Kh Sodium salt
- 4-Chloro-2-methylphenoxyacetic acid sodium salt
- Acetic acid, (4-chloro-2-methylphenoxy)-, sodium salt
- Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1)
- Acetic acid, [(4-chloro-o-tolyl)oxy]-, sodium salt
- Agroxone 3
- Chipton MCPA-Na
- Chwastox
- Chwastox 30
- Chwastox 80
- Chwastox Extra
- Chwastox Extra 300SL
- Chwastox plynny 30
- Dicotex
- Dicotex 80
- Dikoteks
- Dikotex
- Dikotex 30
- Dikotex P
- Estermine
- Hedonal M 80
- MCP sodium salt
- MCPA sodium salt
- MCPA-Na
- Mecomorn 750SL
- Metaxone
- Methoxon
- Methoxone 30
- Methoxone sodium salt
- Na MCPA
- Phenoxilene
- Phenoxylene
- SYS 67ME
- Sodium (2-methyl-4-chlorophenoxy)acetate
- Sodium (4-chloro-2-methylphenoxy)acetate
- Sodium 4-chloro-O-tolyloxyacetate
- Sodium MCP
- Sodium MCPA
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | a0d2e659-6afe-4e4e-bdfe-3241197ebb49 | MCPA-sodium | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | a0d2e659-6afe-4e4e-bdfe-3241197ebb49 | MCPA-sodium | Emissions/Emissions to air/Emissions to urban air close to ground | exactMatch | — |
Characterisation factors
4- consensus-flow-list 2
- European Commission — JRC 2
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 76.894 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 76.894 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 76.894 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 76.894 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "(p-Chloro-o-tolyloxy)acetic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2-Methyl-4-chlorophenoxyacetic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2M-4Kh Sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "4-Chloro-2-methylphenoxyacetic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Acetic acid, (4-chloro-2-methylphenoxy)-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Acetic acid, [(4-chloro-o-tolyl)oxy]-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Agroxone 3",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chipton MCPA-Na",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox 30",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox 80",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox Extra",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox Extra 300SL",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chwastox plynny 30",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dicotex",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dicotex 80",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dikoteks",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dikotex",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dikotex 30",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dikotex P",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Estermine",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Hedonal M 80",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "MCP sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "MCPA sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "MCPA-Na",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Mecomorn 750SL",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Metaxone",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Methoxon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Methoxone 30",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Methoxone sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Na MCPA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phenoxilene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phenoxylene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SYS 67ME",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium (2-methyl-4-chlorophenoxy)acetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium (4-chloro-2-methylphenoxy)acetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 4-chloro-O-tolyloxyacetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium MCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium MCPA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3653-48-3",
"https://commonchemistry.cas.org/detail?cas_rn=3653-48-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C9H8ClNaO3",
"C9H9ClNaO3"
],
"attested_by": {
"C9H9ClNaO3": [
"enrich_references.pubchem_semantic"
],
"C9H8ClNaO3": [
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157445"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"PMNFTMSSBYQNTK-UHFFFAOYSA-N",
"STAPBGVGYWCRTF-UHFFFAOYSA-M"
],
"attested_by": {
"PMNFTMSSBYQNTK-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"STAPBGVGYWCRTF-UHFFFAOYSA-M": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157445"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"(p-Chloro-o-tolyloxy)acetic acid sodium salt"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]"
]
}
],
"attested_by": {
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"(p-Chloro-o-tolyloxy)acetic acid sodium salt"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+]"
]
}
],
"attested_by": {
"InChI=1S/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"(p-Chloro-o-tolyloxy)acetic acid sodium salt"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"(p-Chloro-o-tolyloxy)acetic acid sodium salt"
]
},
"attested_by": {
"(p-Chloro-o-tolyloxy)acetic acid sodium salt": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=3653-48-3",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157445;CAS:3653-48-3"
],
"prov:wasDerivedFrom": "pubchem.identifiers[3653-48-3]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/45157445",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157445;CAS:3653-48-3"
],
"prov:wasDerivedFrom": "pubchem.by_cas[3653-48-3]"
}
}
],
"prefLabel": [
{
"@value": "MCPA-sodium",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/ChemicalSalt"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "a0d2e659-6afe-4e4e-bdfe-3241197ebb49",
"identifier": "a0d2e659-6afe-4e4e-bdfe-3241197ebb49",
"source": "EF 3.1",
"cas_numbers": [
"3653-48-3"
],
"ec_numbers": [
"222-895-9"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Ground level",
"population_density": "Urban (>1000 people/square mile)"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 76.894
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 76.894
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-grle-ur10pesq",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-412588dc22ccf36a",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/a0d2e659-6afe-4e4e-bdfe-3241197ebb49",
"skos:prefLabel": "MCPA-sodium",
"context": "Emissions/Emissions to air/Emissions to urban air close to ground",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/a0d2e659-6afe-4e4e-bdfe-3241197ebb49"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/a0d2e659-6afe-4e4e-bdfe-3241197ebb49"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "bootstrap_labels",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"3653-48-3": "exactMatch"
},
"general_comment": "Correct mapping CAS and flow to be verified: yet unclear whether this is the sodium-, hydrochloride-, calcium-, potassium- or other salt or the pure substance that is emitted. Note that the CAS No is the relevant identifier, to which also the ILCD LCIA characterisation factors relate. Reference elementary flow of the International Reference Life Cycle Data System (ILCD).",
"_transformed": true,
"_provided": {
"name": "MCPA-sodium",
"synonyms": [
"(2-Methyl-4-chlorophenoxy)acetic acid, sodium salt",
"(4-Chloro-2-methylphenoxy) acetate sodium salt",
"(4-Chloro-2-methylphenoxy)acetic acid sodium salt",
"(p-Chloro-o-tolyloxy)acetic acid sodium salt",
"2M-4KH sodium salt",
"4-Chloro-2-methylphenoxyacetate sodium salt",
"4-Chloro-2-methylphenoxyacetic acid sodium salt",
"AC1MC459",
"AKOS003052577",
"Acetic acid, ((4-chloro-o-tolyl)oxy)-, sodium salt",
"Acetic acid, (4-chloro-2-methylphenoxy)-, sodium salt",
"Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1)",
"Agroxone 3",
"Chwastoks",
"Chwastox",
"Chwastox 80",
"Chwastox plynny 30",
"DIKOTEX P",
"Dicotex",
"Dicotex 80",
"Dikoteks",
"Dikotex",
"Dikotex 30",
"Estermine",
"Hedonal M 80",
"Hedonal M80",
"MCP sodium salt",
"MCPA sodium",
"MCPA sodium salt",
"MCPA sodium salt monohydrate",
"MCPA-sodium",
"Metaxone",
"Methoxon",
"Methoxone 30",
"Methoxone sodium salt",
"Phenoxylene",
"SBB060925",
"SYS 67ME",
"Sodium (2-methyl-4-chlorophenoxy)acetate",
"Sodium (4-chloro-2-methylphenoxy)acetate",
"Sodium 2-methyl-4-chlorophenoxyacetate",
"Sodium MCPA",
"U 46M",
"sodium 2-(4-chloro-2-methylphenoxy)acetate"
],
"context": [
"Emissions",
"Emissions to air",
"Emissions to urban air close to ground"
],
"cas_numbers": [
"3653-48-3"
],
"ec_numbers": [
"222-895-9"
],
"unit": "kg"
}
}
Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works