Boron Carbide
c487bb82-cb67-4a1d-be3e-b17f2a902d78
Identity
- Substance
- fo-279343eca1c6b84f Neutral molecule
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Long-term
- CAS
- 12069-32-8
- EC
- 235-111-5
Context
- Dimension
- Environmental
- Media
- Air
- Strata
- Long-term
Alternative labels
16- 1500F
- B 4C-C1005
- Borcarbid HD 20
- Boron carbide (B0.8C0.2)
- Boron carbide (B12C3)
- Boron carbide (B4C)
- Boron carbide (BC0.25)
- Ceralloy 546-3E
- Denkaboron F 1
- HS
- HS (carbide)
- Norbide
- Stark HS
- Tetraboron carbide
- Tetraboron monocarbide
- ZT-BC 60
Source lists
3| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | c487bb82-cb67-4a1d-be3e-b17f2a902d78 | Boron carbide | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
| ecoinvent | 3.12 | 454e32e4-09f5-4155-ae4c-7deab810a4b2 | Boron carbide | The CAS numbers are the same (12069-32-8); both name the same compartment. |
| ecoinvent | 3.8 | 454e32e4-09f5-4155-ae4c-7deab810a4b2 | Boron carbide | The CAS numbers are the same (12069-32-8); both name the same compartment. |
Concept associations
3| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | c487bb82-cb67-4a1d-be3e-b17f2a902d78 | Boron carbide | Emissions/Emissions to air/Emissions to air, unspecified (long-term) | exactMatch | — |
| ecoinvent 3.12 | 454e32e4-09f5-4155-ae4c-7deab810a4b2 | Boron Carbide | air / low population density, long-term | closeMatch | — |
| ecoinvent 3.8 | 454e32e4-09f5-4155-ae4c-7deab810a4b2 | Boron Carbide | air / low population density, long-term | closeMatch | — |
Characterisation factors
4- consensus-flow-list 2 (0 non-zero)
- European Commission — JRC 2 (0 non-zero)
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 0 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 0 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_inorganics | — | 0 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_inorganics | — | 0 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "1500F",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "B 4C-C1005",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Borcarbid HD 20",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Boron carbide (B0.8C0.2)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Boron carbide (B12C3)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Boron carbide (B4C)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Boron carbide (BC0.25)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ceralloy 546-3E",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Denkaboron F 1",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "HS",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "HS (carbide)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Norbide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Stark HS",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tetraboron carbide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tetraboron monocarbide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "ZT-BC 60",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:12069-32-8",
"https://commonchemistry.cas.org/detail?cas_rn=12069-32-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"CB4"
],
"attested_by": {
"CB4": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279",
"CID:5136269"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"B12B3C14B2B43"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"INAHAJYZKVIDIZ-UHFFFAOYSA-N",
"NOJMLSPGQSYAIT-UHFFFAOYSA-N"
],
"attested_by": {
"INAHAJYZKVIDIZ-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"NOJMLSPGQSYAIT-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279",
"CID:5136269"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"B12B3C14B2B43"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"B12B3C14B2B43",
"B1=BB=C=B1"
],
"attested_by": {
"B12B3C14B2B43": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
],
"B1=BB=C=B1": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279",
"CID:5136269"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"B12B3C14B2B43"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/CB4/c1-2-4-5-3-1",
"InChI=1S/CB4/c2-1-3(2)5(1)4(1)2"
],
"attested_by": {
"InChI=1S/CB4/c1-2-4-5-3-1": [
"enrich_references.pubchem_semantic"
],
"InChI=1S/CB4/c2-1-3(2)5(1)4(1)2": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279",
"CID:5136269"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"B12B3C14B2B43"
]
}
]
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"@value": [
"1,2,3,4-tetraboracyclopenta-2,4,5-triene",
"2,3,4,5-tetraboratetracyclo[2.1.0.01,3.02,5]pentane"
],
"attested_by": {
"1,2,3,4-tetraboracyclopenta-2,4,5-triene": [
"enrich_references.pubchem_semantic"
],
"2,3,4,5-tetraboratetracyclo[2.1.0.01,3.02,5]pentane": [
"enrich_references.pubchem_semantic"
]
},
"rdfs:label": "IUPAC name",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279",
"CID:5136269"
],
"prov:wasDerivedFrom": "pubchem.identifiers.IUPAC Name"
}
}
},
"references": [
{
"@id": "https://chem.echa.europa.eu/100.031.410",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.031.907",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.032.335",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.056.383",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=12069-32-8",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"12069-32-8"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID4051615",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://en.wikipedia.org/wiki/Boron_carbide",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/T5V24LJ508",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://hts.usitc.gov/search?query=2849.90.10.00",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/123279",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.by_cas[12069-32-8]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/5136269",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:5136269;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.by_cas[12069-32-8]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q417399",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:123279;CAS:12069-32-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[12069-32-8]"
}
}
],
"prefLabel": [
{
"@value": "Boron Carbide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "c487bb82-cb67-4a1d-be3e-b17f2a902d78",
"identifier": "c487bb82-cb67-4a1d-be3e-b17f2a902d78",
"source": "EF 3.1",
"cas_numbers": [
"12069-32-8"
],
"ec_numbers": [
"235-111-5"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Long-term"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.0
},
{
"method_uuid": "dacd48b5-4da5-49aa-aff4-cd5f5495c037",
"name": "Ecotoxicity, freshwater_inorganics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.0
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-lote",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-279343eca1c6b84f",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/c487bb82-cb67-4a1d-be3e-b17f2a902d78",
"skos:prefLabel": "Boron carbide",
"context": "Emissions/Emissions to air/Emissions to air, unspecified (long-term)",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
},
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ecoinvent/3.12/flow/454e32e4-09f5-4155-ae4c-7deab810a4b2",
"skos:prefLabel": "Boron Carbide",
"context": "air / low population density, long-term",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:closeMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
},
"provenance": {
"prov:wasGeneratedBy": "merge_ecoinvent",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent:3.12:454e32e4-09f5-4155-ae4c-7deab810a4b2",
"Boron Carbide",
"",
"algorithm.lookup_order=cas>ec>label",
"algorithm.basis=cas:12069-32-8",
"algorithm.flow_object_candidates=1",
"algorithm.elementary_candidates=14",
"algorithm.selector_reason=exact-context-iri-match",
"algorithm.score_rule=exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
],
"prov:wasDerivedFrom": "algorithmic_fallback:lookup_order(cas>ec>label);basis(cas:12069-32-8);flow_object_candidates(1);elementary_candidates(14);selector(exact-context-iri-match);exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
}
},
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ecoinvent/3.8/flow/454e32e4-09f5-4155-ae4c-7deab810a4b2",
"skos:prefLabel": "Boron Carbide",
"context": "air / low population density, long-term",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:closeMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/c487bb82-cb67-4a1d-be3e-b17f2a902d78"
},
"provenance": {
"prov:wasGeneratedBy": "merge_ecoinvent",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent:3.8:454e32e4-09f5-4155-ae4c-7deab810a4b2",
"Boron Carbide",
"",
"algorithm.lookup_order=cas>ec>label",
"algorithm.basis=cas:12069-32-8",
"algorithm.flow_object_candidates=1",
"algorithm.elementary_candidates=14",
"algorithm.selector_reason=exact-context-iri-match",
"algorithm.score_rule=exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
],
"prov:wasDerivedFrom": "algorithmic_fallback:lookup_order(cas>ec>label);basis(cas:12069-32-8);flow_object_candidates(1);elementary_candidates(14);selector(exact-context-iri-match);exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"12069-32-8": "exactMatch"
},
"_transformed": true,
"_provided": {
"name": "Boron carbide",
"synonyms": [],
"context": [
"Emissions",
"Emissions to air",
"Emissions to air, unspecified (long-term)"
],
"cas_numbers": [
"12069-32-8"
],
"ec_numbers": [
"235-111-5"
],
"unit": "kg"
}
}Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works