Bromate
cbfb410d16bf2e6ca5aa4903a1681014adca5103
Identity
- Substance
- fo-50456697c7ae38f0 Molecular anion
- Source
- bafu algorithm addition
- Unit
- kg
- Context
- Environmental → Water → River
- CAS
- 15541-45-4
- EC
- —
Context
- Dimension
- Environmental
- Media
- Water
- Water body
- River
Alternative labels
11- [BrO3](-)
- BrO3(-)
- Bromate (BrO3(1-))
- Bromate (BrO3-)
- Bromate (BrO31-)
- Bromate ion
- Bromate ion (BrO3-)
- Bromate ion (BrO31-)
- Bromate(1-)
- Bromic acid, ion(1-)
- trioxidobromate(1-)
Source lists
2| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| agribalyse | 3.2 | c5148d6f-6181-58de-858d-35064de225c9 | Bromate | The CAS numbers are the same (15541-45-4); both name the same compartment. |
| bafu | 2026-v1 | 295b4f58-d7c3-508e-979b-e61532addd5c | Bromate | The CAS numbers are the same (15541-45-4); no flow of this substance sat in that compartment, so this one was created for the row. |
Concept associations
2| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| bafu 2026-v1 | 295b4f58-d7c3-508e-979b-e61532addd5c | Bromate | emissions to water / river | exactMatch | — |
| agribalyse 3.2 | c5148d6f-6181-58de-858d-35064de225c9 | Bromate | Emissions to water / river | closeMatch | — |
Characterisation factors
2- consensus-flow-list 2
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 156.99 | carried |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_inorganics | — | 156.99 | carried |
History
The change log and the PROV-O trail (0 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "[BrO3](-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "BrO3(-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
},
{
"@value": "Bromate (BrO3(1-))",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate (BrO3-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate (BrO31-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate ion",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate ion (BrO3-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate ion (BrO31-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromate(1-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bromic acid, ion(1-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:15541-45-4",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=15541-45-4"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "trioxidobromate(1-)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "chebi_altlabels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1",
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi synonym match"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"BrO3",
"BrO3-"
],
"attested_by": {
"BrO3": [
"enrich_references.chebi_semantic"
],
"BrO3-": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.generalized_empirical_formula"
},
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[O-][Br+2]([O-])[O-]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"[O-][Br+2]([O-])[O-]"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Bromate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[O-][Br+2]([O-])[O-]"
]
}
],
"attested_by": {
"[O-][Br+2]([O-])[O-]": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/BrO3/c2-1(3)4/q-1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Bromate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[O-][Br+2]([O-])[O-]"
]
}
],
"attested_by": {
"InChI=1S/BrO3/c2-1(3)4/q-1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"KYHSUUVXZLFMQS-UHFFFAOYSA-N",
"SXDBWCPKPHAZSM-UHFFFAOYSA-M"
],
"attested_by": {
"SXDBWCPKPHAZSM-UHFFFAOYSA-M": [
"enrich_references.chebi_semantic",
"enrich_references.pubchem_semantic"
],
"KYHSUUVXZLFMQS-UHFFFAOYSA-N": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.inchi_key_string"
},
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=Br(=O)[O-]"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"[O-][Br+2]([O-])[O-]"
]
}
]
},
"https://w3id.org/chemrof/elemental_charge": {
"@id": "https://w3id.org/chemrof/elemental_charge",
"@value": [
-1
],
"attested_by": {
"-1": [
"enrich_references.chebi_semantic"
]
},
"rdfs:label": "Elemental charge",
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/NUM",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.basic_property_values.charge"
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Bromate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Bromate"
]
},
"attested_by": {
"Bromate": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "gmelin:1888",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J1.601.245I",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[15541-45-4]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=15541-45-4",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_xrefs",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.xrefs_urls"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID8023923",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[15541-45-4]"
}
},
{
"@id": "https://en.wikipedia.org/wiki/Bromate",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[15541-45-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/84979",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.by_cas[15541-45-4]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#1450",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[15541-45-4]"
}
},
{
"@id": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:29223",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.chebi_id_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"http://purl.obolibrary.org/obo/CHEBI_29223"
],
"prov:wasDerivedFrom": "chebi.id"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q414591",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:84979;CAS:15541-45-4"
],
"prov:wasDerivedFrom": "pubchem.identifiers[15541-45-4]"
}
}
],
"prefLabel": [
{
"@value": "Bromate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/MolecularAnion"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "cbfb410d16bf2e6ca5aa4903a1681014adca5103",
"identifier": "",
"name": "Bromate",
"source": "bafu algorithm addition",
"cas_numbers": [
"15541-45-4"
],
"ec_numbers": [],
"context": {
"dimension": "Environmental",
"media": "Water",
"water_body": "River"
},
"synonyms": [],
"lcia_methods": [],
"unit": "kg",
"input_datasets": [],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-wate-rive",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-50456697c7ae38f0",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/bafu/2026-v1/flow/295b4f58-d7c3-508e-979b-e61532addd5c",
"skos:prefLabel": "Bromate",
"context": "emissions to water / river",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/cbfb410d16bf2e6ca5aa4903a1681014adca5103"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/cbfb410d16bf2e6ca5aa4903a1681014adca5103"
},
"provenance": {
"prov:wasGeneratedBy": "merge_bafu",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"bafu:2026-v1:295b4f58-d7c3-508e-979b-e61532addd5c",
"Bromate",
"",
"algorithm.lookup_order=cas>ec>label",
"algorithm.basis=cas:15541-45-4",
"algorithm.flow_object_candidates=1",
"algorithm.elementary_candidates=14",
"algorithm.selector_reason=new-elementary-flow-created",
"algorithm.score_rule=exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto",
"algorithm.winning_score=3",
"algorithm.tie_on_top_score=true"
],
"prov:wasDerivedFrom": "algorithmic_fallback:lookup_order(cas>ec>label);basis(cas:15541-45-4);flow_object_candidates(1);elementary_candidates(14);selector(new-elementary-flow-created);exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
}
},
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/agribalyse/3.2/flow/c5148d6f-6181-58de-858d-35064de225c9",
"skos:prefLabel": "Bromate",
"context": "Emissions to water / river",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:closeMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/cbfb410d16bf2e6ca5aa4903a1681014adca5103"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/cbfb410d16bf2e6ca5aa4903a1681014adca5103"
},
"provenance": {
"prov:wasGeneratedBy": "merge_agribalyse",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"agribalyse:3.2:c5148d6f-6181-58de-858d-35064de225c9",
"Bromate",
"",
"algorithm.lookup_order=cas>ec>label",
"algorithm.basis=cas:15541-45-4",
"algorithm.flow_object_candidates=1",
"algorithm.elementary_candidates=15",
"algorithm.selector_reason=exact-context-iri-match",
"algorithm.score_rule=exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
],
"prov:wasDerivedFrom": "algorithmic_fallback:lookup_order(cas>ec>label);basis(cas:15541-45-4);flow_object_candidates(1);elementary_candidates(15);selector(exact-context-iri-match);exact-iri-shortcircuit;up-tree-filter;score=(2*unit_exact)+context_overlap-context_penalty+context_iri_exact;contradiction-veto"
}
}
],
"_sources": {},
"cas_match_labels": {},
"general_comment": "",
"_transformed": false,
"_provided": {
"name": null,
"synonyms": [],
"context": [],
"cas_numbers": [],
"ec_numbers": [],
"unit": null
},
"elementary_flow_id": "cbfb410d16bf2e6ca5aa4903a1681014adca5103"
}Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works