Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate
cc3c4316-e3a5-4825-8d19-5834480b58c8
Identity
- Substance
- fo-39c41a2d7e75c555 Chemical salt
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Ground → Unknown
- CAS
- 3965-55-7
- EC
- 223-578-8
Context
- Dimension
- Environmental
- Geography
- Unknown
- Media
- Ground
Alternative labels
21- 1,3-Benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt
- 1,3-Benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt (1:1)
- 3,5-Bis(carbomethoxy)benzenesulfonic acid sodium salt
- 3,5-Di(carbomethoxy)benzenesulfonic acid sodium salt
- 5-Sulfoisophthalic acid dimethyl ester sodium salt
- DM Sip
- Dimethyl 5-(sodiosulfo)isophthalate
- Dimethyl 5-sulfoisophthalate sodium salt
- Dimethyl isophthalate sodium 5-sulfonate
- Dimethyl isophthalate-5-sulfonic acid sodium salt
- Dimethyl sodium 5-sulfoisophthalate
- Dimethyl sulfoisophthalate sodium salt
- Isophthalic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt
- SIPM
- Sodium 3,5-(dimethoxycarbonyl)benzenesulfonate
- Sodium 3,5-bis(carbomethoxy)benzenesulfonate
- Sodium 3,5-di(carbomethoxy)benzenesulfonate
- Sodium 5-sulfoisophthalic acid dimethyl ester
- Sodium dimethyl 5-sulfoisophthalate
- Sodium dimethyl 5-sulfonatoisophthalate
- Ukanol DM Sip
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | cc3c4316-e3a5-4825-8d19-5834480b58c8 | sodium 3,5-bis(methoxycarbonyl)benzenesulfonate | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | cc3c4316-e3a5-4825-8d19-5834480b58c8 | sodium 3,5-bis(methoxycarbonyl)benzenesulfonate | Emissions/Emissions to soil/Emissions to soil, unspecified | exactMatch | — |
Characterisation factors
8- consensus-flow-list 4
- European Commission — JRC 4
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 23.969 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 23.969 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 23.969 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 23.969 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, non-cancer | — | 1.0843e-08 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, non-cancer | — | 1.0843e-08 | sole |
| EF 3.1 | European Commission — JRC | Human toxicity, non-cancer_organics | — | 1.0843e-08 | — |
| EF 3.1 | consensus-flow-list | Human toxicity, non-cancer_organics | — | 1.0843e-08 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "1,3-Benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1,3-Benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt (1:1)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "3,5-Bis(carbomethoxy)benzenesulfonic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "3,5-Di(carbomethoxy)benzenesulfonic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "5-Sulfoisophthalic acid dimethyl ester sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "DM Sip",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl 5-(sodiosulfo)isophthalate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl 5-sulfoisophthalate sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl isophthalate sodium 5-sulfonate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl isophthalate-5-sulfonic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl sodium 5-sulfoisophthalate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dimethyl sulfoisophthalate sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Isophthalic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SIPM",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 3,5-(dimethoxycarbonyl)benzenesulfonate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 3,5-bis(carbomethoxy)benzenesulfonate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 3,5-di(carbomethoxy)benzenesulfonate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 5-sulfoisophthalic acid dimethyl ester",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium dimethyl 5-sulfoisophthalate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium dimethyl 5-sulfonatoisophthalate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ukanol DM Sip",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3965-55-7",
"https://commonchemistry.cas.org/detail?cas_rn=3965-55-7"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C10H10NaO7S",
"C10H9NaO7S"
],
"attested_by": {
"C10H10NaO7S": [
"enrich_references.pubchem_semantic"
],
"C10H9NaO7S": [
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157439"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"LLHSEQCZSNZLRI-UHFFFAOYSA-M",
"YYYWHHMCKHITRA-UHFFFAOYSA-N"
],
"attested_by": {
"YYYWHHMCKHITRA-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"LLHSEQCZSNZLRI-UHFFFAOYSA-M": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157439"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]"
]
}
],
"attested_by": {
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C10H10O7S.Na/c1-16-9(11)6-3-7(10(12)17-2)5-8(4-6)18(13,14)15;/h3-5H,1-2H3,(H,13,14,15);/q;+1/p-1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+]"
]
}
],
"attested_by": {
"InChI=1S/C10H10O7S.Na/c1-16-9(11)6-3-7(10(12)17-2)5-8(4-6)18(13,14)15;/h3-5H,1-2H3,(H,13,14,15);/q;+1/p-1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate"
]
},
"attested_by": {
"Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "https://chem.echa.europa.eu/100.021.436",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157439;CAS:3965-55-7"
],
"prov:wasDerivedFrom": "pubchem.identifiers[3965-55-7]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=3965-55-7",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157439;CAS:3965-55-7"
],
"prov:wasDerivedFrom": "pubchem.identifiers[3965-55-7]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/45157439",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45157439;CAS:3965-55-7"
],
"prov:wasDerivedFrom": "pubchem.by_cas[3965-55-7]"
}
}
],
"prefLabel": [
{
"@value": "Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/ChemicalSalt"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "cc3c4316-e3a5-4825-8d19-5834480b58c8",
"identifier": "cc3c4316-e3a5-4825-8d19-5834480b58c8",
"source": "EF 3.1",
"cas_numbers": [
"3965-55-7"
],
"ec_numbers": [
"223-578-8"
],
"context": {
"dimension": "Environmental",
"media": "Ground",
"geography": "Unknown"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 23.969
},
{
"method_uuid": "7cfdcfcf-b222-4b26-888a-a55f9fbf7ac8",
"name": "Human toxicity, non-cancer",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 1.0843e-8
},
{
"method_uuid": "8c3141e9-1f15-43b5-bff2-182e49893a46",
"name": "Human toxicity, non-cancer_organics",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 1.0843e-8
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 23.969
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-grou-unkn",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-39c41a2d7e75c555",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/cc3c4316-e3a5-4825-8d19-5834480b58c8",
"skos:prefLabel": "sodium 3,5-bis(methoxycarbonyl)benzenesulfonate",
"context": "Emissions/Emissions to soil/Emissions to soil, unspecified",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/cc3c4316-e3a5-4825-8d19-5834480b58c8"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/cc3c4316-e3a5-4825-8d19-5834480b58c8"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"3965-55-7": "exactMatch"
},
"_transformed": true,
"_provided": {
"name": "sodium 3,5-bis(methoxycarbonyl)benzenesulfonate",
"synonyms": [
"organic",
"sodiumdimethyl5-sulphonatoisophthalate"
],
"context": [
"Emissions",
"Emissions to soil",
"Emissions to soil, unspecified"
],
"cas_numbers": [
"3965-55-7"
],
"ec_numbers": [
"223-578-8"
],
"unit": "kg"
}
}
Something wrong here?
A flow can be wrong in three ways, and they are decided differently. Pick the one that matches what you are looking at.
- A row from my list should not reach this flow
- This flow is not that chemical
- The compartment or the unit is wrong
- One of these characterisation factors cannot be this substance's
You do not need to run a build or clone anything. Name the row and say what your evidence is; the measurement is done for you. How contributing works