Benzoyl peroxide
Everything that changed this flow. Back to the flow
f0c42cf8-adcc-4bee-a11b-af99903af731
By field
13 fields| Field | Changes | Written by | Latest note |
|---|---|---|---|
| altLabel | 5 | chebi_altlabels, consensus_match, strip_catalogue_altlabels, strip_product_families | Removed 65 product-family altLabel value(s) from 5 famil(y/ies): 'cadox' (6, e.g. 'Cadox 40E'), 'lucidol' (18, e.g. 'Lucidol 40E'), 'luperox' (12, e.g. 'Luperox 78'), 'perkadox' (21, e.g. 'Perkadox 20S'), 'peroxan' (8, e.g. 'Peroxan BP 40LV') |
| properties | 5 | enrich_references, normalise_property_values, opsin_iupac, rdkit_post_consensus, rdkit_pre_consensus | typed the way the ontology types it |
| prefLabel | 3 | bootstrap_labels, consensus_match, normalize_name_case | cas=94-36-0; cc_chebi_agreed_name='Benzoyl peroxide'; object_uuid=fo-6e34f60c97b0a55d |
| cas_match_labels | 1 | consensus_match | group_key=diphenylperoxyanhydride||dimension=Environmental > media=Water > water_body=Unknown; group_sources=['chebi', 'ec_inventory', 'pubchem']; cas_sources={'94-36-0': ['chebi', 'ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-6e34f60c97b0a55d: {'94-36-0': 'exactMatch'} |
| concept_associations | 1 | carry_associations_onto_flows | associations resolved on the elementary layer |
| context | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to water, unspecified (long-term) |
| context_iri | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to water, unspecified (long-term) |
| name | 1 | bootstrap_labels | Purged legacy name field to enforce prefLabel usage |
| references | 1 | enrich_references | Added references with provenance; cas_numbers=['94-36-0']; matched_chebi_ids=['http://purl.obolibrary.org/obo/CHEBI_82405']; candidate_pubchem_cids=[7187, 18680001]; selected_pubchem_cids=[7187]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| skos_definition | 1 | enrich_references | Merged ChEBI/PubChem definitions into skos:definition |
| synonyms | 1 | bootstrap_labels | Removed legacy synonyms field in favor of structured labels |
| types | 1 | link_flows_to_their_substance | the substance's answer, copied onto its flow |
| unit_iri | 1 | unit_normalization | Unit IRI set from normalization of 'kg' |
Where several steps wrote one field, the last one won — and the log below shows the sequence.
Changes
23| # | Step | Field | From | To | Why |
|---|---|---|---|---|---|
| 5,689 | bootstrap_labels | prefLabel | — | [{"@value":"diphenylperoxyanhydride","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttri… | Bootstrapped prefLabel from legacy name field |
| 5,690 | bootstrap_labels | name | diphenylperoxyanhydride | — | Purged legacy name field to enforce prefLabel usage |
| 5,691 | bootstrap_labels | synonyms | ["organic","benzoylperoxide","dibenzoylperoxide","benzoicacid,peroxide","benzoperoxide","benzoylperoxide,remainderwater… | [] | Removed legacy synonyms field in favor of structured labels |
| 193,643 | default_context_mapping | context | — | {"dimension":"Environmental","media":"Water","water_body":"Long-term"} | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to water, unspecified (long-term) |
| 193,644 | default_context_mapping | context_iri | — | https://vocab.brightway.one/flow-contexts/envi-wate-lote | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to water, unspecified (long-term) |
| 215,242 | unit_normalization | unit_iri | — | https://vocab.brightway.one/units/unit/KiloGM | Unit IRI set from normalization of 'kg' |
| 222,413 | normalize_name_case | prefLabel | [{"@value":"diphenylperoxyanhydride","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttri… | [{"@value":"Diphenylperoxyanhydride","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttri… | Title-cased words without internal capitals (preserved words with uppercase letters beyond the first character) |
| 232,659 | enrich_references | properties | {} | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | Added ChEBI/PubChem properties (chebi_ids=1, pubchem_cids=1) |
| 232,660 | enrich_references | skos_definition | — | [] | Merged ChEBI/PubChem definitions into skos:definition |
| 232,661 | enrich_references | references | [] | [{"@id":"drugcentral:328","provenance":{"prov:wasGeneratedBy":"enrich_references.chebi_xrefs","prov:wasAttributedTo":"c… | Added references with provenance; cas_numbers=['94-36-0']; matched_chebi_ids=['http://purl.obolibrary.org/obo/CHEBI_82405']; candidate_pubchem_cids=[7187, 18680001]; selected_pubchem_cids=[7187]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| 249,899 | rdkit_pre_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | rdkit_pre_consensus from 'C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2'; added: monoisotopic_mass |
| 255,102 | chebi_altlabels | altLabel | [] | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | Added 5 ChEBI synonym(s) as altLabel from 1 linked ChEBI record(s) |
| 266,266 | consensus_match | prefLabel | [{"@value":"Diphenylperoxyanhydride","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttri… | [{"@value":"Benzoyl peroxide","@language":"en","source":{"prov:wasGeneratedBy":"consensus_match","prov:wasAttributedTo"… | cas=94-36-0; cc_chebi_agreed_name='Benzoyl peroxide'; object_uuid=fo-6e34f60c97b0a55d |
| 266,267 | consensus_match | altLabel | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | cas=94-36-0; added original name as altLabel after CC/ChEBI rename; object_uuid=fo-6e34f60c97b0a55d |
| 266,268 | consensus_match | altLabel | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | group_key=diphenylperoxyanhydride||dimension=Environmental > media=Water > water_body=Unknown; cas=94-36-0; added Common Chemistry CAS names as altLabel: 617P37, Abcat 40, Acne-Aid Cream, Acnegel, Acnezoyl, Akneroxide L, Aksil 5, Aztec BP 50FT, B 75W, B 802244, B 83771, BM 50R, BP, BP 40SAQ, BP 50FT, BP 50FT1, BPO, BPO 50, BPO 50F, BTW 50, Basiron, Benbel C, Benox 50, Benox A 80, Benzac, Benzac W, Benzagel, Benzagel 10, Benzaknen, Benzashave, Brevoxyl, C 1A, C 1A (peroxide), CH 50, CH 50L, Cadet BPO, Cadet BPO 78W, Cadox 40E, Cadox B, Cadox B 40E, Cadox B 40ES, Cadox B 50P, Cadox B 75W, Cadox B-CH 50, Chaloxyd BP 50FT, Clear By Design, Debroxide, Degament H, Desanden, Desquam E, Desquam X, Dibenzoyl peroxide, Dry and Clear, Epi-Clear, Epsolay, Fivenox B 50G, G 20, Interox BP 50P1, Interox GZ-S, Link-Cup DBP, Loroxide, Lucidol, Lucidol (peroxide), Lucidol 40E, Lucidol 50P, Lucidol 70, Lucidol 75, Lucidol 75FP, Lucidol 75W, Lucidol 78, Lucidol 98, Lucidol B 50, Lucidol BT 50, Lucidol BW 50T, Lucidol CH 50, Lucidol CH 50L, Lucidol CH 50X, Lucidol G 20, Lucidol KL 50, Lucidol S 50, Lucidol W 40, Luperco AA, Luperco ANS, Luperco AST, Luperox 78, Luperox 98, Luperox A 40FP-EZ9, Luperox A 70S, Luperox A 75, Luperox A 75FP, Luperox A 98, Luperox ACP 35, Luperox AFR 40, Luperox ANS 50G, Luperox APF 55, Luperox ATC 50, Luprox A 75C, MeSH ID: D001585, Micure BP, NSC 671, NSC 675, Nericur, Niper BMT, Niper BW, Nyper B, Nyper BD, Nyper BMT, Nyper BMT 40, Nyper BMT 40SV, Nyper BMT-K, Nyper BO, Nyper BO-Y, Nyper BS, Nyper BW, Nyper F, Nyper FF, Nyper FF-K, Nyper NS, Oxy-5, Oxy-L, Oxycare 42, Oxylite, PEROX-B 75, PEROX-B 95, PHisoAc BP, Panoxyl, Perkadox 20S, Perkadox 33, Perkadox 40, Perkadox BT 50, Perkadox BTW 50, Perkadox CH 50, Perkadox CH 50L, Perkadox CH 50X, Perkadox GB 50, Perkadox GB 50L, Perkadox GB 50X, Perkadox L 40ES, Perkadox L 40RPS, Perkadox L 50S, Perkadox L 50S-PS, Perkadox L-DFG, Perkadox L-W 35FCC, Perkadox L-W 40, Perkadox L-W 40TCP, Perkadox L-W 75, Perkadox L-W 75LS, Perkadox PM 50S, Peroxan BP 40LV, Peroxan BP 40WS, Peroxan BP 50, Peroxan BP 50 Red, Peroxan BP 50PF, Peroxan BP 50PF1, Peroxan BP 50SE, Peroxan BP Powder 50W, Peroxan BP paste 50PF1, Peroxide, dibenzoyl, Peroxyderm, Persa-Gel, Persadox, Preoxydex, Retic BP 50, STR 9100, Sanoxit, Sanperox BPO, SikaFast 5200B, Solugel, Solugel (peroxide), Superox 46-750, Superox 744, TC 1, TC 1 (peroxide), Theraderm, Triaz, Vanoxide, Varox ANS, W 75, W 75 (peroxide), Xerac BP 10, Xerac BP 5; object_uuid=fo-6e34f60c97b0a55d |
| 266,269 | consensus_match | cas_match_labels | — | {"94-36-0":"exactMatch"} | group_key=diphenylperoxyanhydride||dimension=Environmental > media=Water > water_body=Unknown; group_sources=['chebi', 'ec_inventory', 'pubchem']; cas_sources={'94-36-0': ['chebi', 'ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-6e34f60c97b0a55d: {'94-36-0': 'exactMatch'} |
| 275,034 | opsin_iupac | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | opsin_iupac: set authoritative IUPAC name, SMILES, InChI from 'Benzoyl peroxide' |
| 281,524 | rdkit_post_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | rdkit_post_consensus from 'O=C(OOC(=O)c1ccccc1)c1ccccc1'; confirmed: smiles_string, inchi2d_string, inchi2d_key_string, molecular_formula, molecular_mass, monoisotopic_mass |
| 288,428 | strip_catalogue_altlabels | altLabel | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | Removed 20 catalogue altLabel value(s): 'B 75W' (grade code), 'B 83771' (grade code), 'BM 50R' (grade code), 'BPO 50' (grade code), 'BPO 50F' (grade code), 'BTW 50' (grade code), 'C 1A' (grade code), 'C 1A (peroxide)' (grade code), 'CH 50' (grade code), 'CH 50L' (grade code), 'G 20' (grade code), 'NSC 671' (registry code), 'NSC 675' (registry code), 'Oxy-5' (grade code), 'STR 9100' (grade code), 'Superox 744' (trade name), 'TC 1' (grade code), 'TC 1 (peroxide)' (grade code), 'W 75' (grade code), 'W 75 (peroxide)' (grade code) |
| 291,896 | strip_product_families | altLabel | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | [{"@value":"acetoxyl","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov:wasAttributedTo":"consen… | Removed 65 product-family altLabel value(s) from 5 famil(y/ies): 'cadox' (6, e.g. 'Cadox 40E'), 'lucidol' (18, e.g. 'Lucidol 40E'), 'luperox' (12, e.g. 'Luperox 78'), 'perkadox' (21, e.g. 'Perkadox 20S'), 'peroxan' (8, e.g. 'Peroxan BP 40LV') |
| 377,883 | carry_associations_onto_flows | concept_associations | [] | [{"@type":"xkos:ConceptAssociation","xkos:sourceConcept":{"@id":"https://vocab.brightway.one/ef/3.1/flow/f0c42cf8-adcc-… | associations resolved on the elementary layer |
| 389,368 | normalise_property_values | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C14H10O4"]… | typed the way the ontology types it |
| 396,467 | link_flows_to_their_substance | types | — | ["https://w3id.org/chemrof/NeutralMolecule"] | the substance's answer, copied onto its flow |
PROV-O trail
23 activitiesOne activity per change: which version of the flow it consumed, and which it produced. The values are on the change with the same number — stored once, not twice.
| Activity | Field | Agent | Used | Generated |
|---|---|---|---|---|
| ef:activity/change/20260920T1042228874600000/5689 | prefLabel | ef:agent/bootstrap_labels | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v0 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v1 |
| ef:activity/change/20260920T1042228874600000/5690 | name | ef:agent/bootstrap_labels | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v1 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v2 |
| ef:activity/change/20260920T1042228874600000/5691 | synonyms | ef:agent/bootstrap_labels | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v2 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v3 |
| ef:activity/change/20260920T1042228874600000/193643 | context | ef:agent/default_context_mapping | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v3 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v4 |
| ef:activity/change/20260920T1042228874600000/193644 | context_iri | ef:agent/default_context_mapping | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v4 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v5 |
| ef:activity/change/20260920T1042228874600000/215242 | unit_iri | ef:agent/unit_normalization | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v5 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v6 |
| ef:activity/change/20260920T1042228874600000/222413 | prefLabel | ef:agent/normalize_name_case | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v6 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v7 |
| ef:activity/change/20260920T1042228874600000/232659 | properties | ef:agent/enrich_references | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v7 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v8 |
| ef:activity/change/20260920T1042228874600000/232660 | skos_definition | ef:agent/enrich_references | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v8 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v9 |
| ef:activity/change/20260920T1042228874600000/232661 | references | ef:agent/enrich_references | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v9 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v10 |
| ef:activity/change/20260920T1042228874600000/249899 | properties | ef:agent/rdkit_pre_consensus | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v10 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v11 |
| ef:activity/change/20260920T1042228874600000/255102 | altLabel | ef:agent/chebi_altlabels | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v11 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v12 |
| ef:activity/change/20260920T1042228874600000/266266 | prefLabel | ef:agent/consensus_match | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v12 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v13 |
| ef:activity/change/20260920T1042228874600000/266267 | altLabel | ef:agent/consensus_match | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v13 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v14 |
| ef:activity/change/20260920T1042228874600000/266268 | altLabel | ef:agent/consensus_match | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v14 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v15 |
| ef:activity/change/20260920T1042228874600000/266269 | cas_match_labels | ef:agent/consensus_match | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v15 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v16 |
| ef:activity/change/20260920T1042228874600000/275034 | properties | ef:agent/opsin_iupac | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v16 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v17 |
| ef:activity/change/20260920T1042228874600000/281524 | properties | ef:agent/rdkit_post_consensus | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v17 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v18 |
| ef:activity/change/20260920T1042228874600000/288428 | altLabel | ef:agent/strip_catalogue_altlabels | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v18 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v19 |
| ef:activity/change/20260920T1042228874600000/291896 | altLabel | ef:agent/strip_product_families | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v19 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v20 |
| ef:activity/change/20260920T1042228874600000/377883 | concept_associations | ef:agent/carry_associations_onto_flows | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v20 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v21 |
| ef:activity/change/20260920T1042228874600000/389368 | properties | ef:agent/normalise_property_values | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v21 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v22 |
| ef:activity/change/20260920T1042228874600000/396467 | types | ef:agent/link_flows_to_their_substance | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v22 | ef:flow/f0c42cf8-adcc-4bee-a11b-af99903af731/v23 |